Difference between revisions of "CPD-9956"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ09376 == * transcription-direction: ** negative * right-end-position: ** 551075 * left-end-position: ** 542795 * centisome-position: ** 66.14152...") |
(Created page with "Category:metabolite == Metabolite CPD-9956 == * common-name: ** ubiquinol-8 * smiles: ** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c(o)=c(oc)c(oc)...") |
||
| (8 intermediate revisions by 2 users not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite CPD-9956 == |
| − | * | + | * common-name: |
| − | ** | + | ** ubiquinol-8 |
| − | * | + | * smiles: |
| − | ** | + | ** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c(o)=c(oc)c(oc)=c(o)c(c)=1) |
| − | * | + | * inchi-key: |
| − | ** | + | ** lojuqfspyhmheo-sghxuwjisa-n |
| − | * | + | * molecular-weight: |
| − | ** | + | ** 729.137 |
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[R00281]] |
| − | == Reaction(s) | + | * [[SUCDH_LPAREN_q8_RPAREN_m]] |
| − | * [[ | + | == Reaction(s) known to produce the compound == |
| − | * | + | * [[DHHB-METHYLTRANSFER-RXN]] |
| − | + | * [[R00281]] | |
| − | * | + | * [[SUCDH_LPAREN_q8_RPAREN_m]] |
| − | + | == Reaction(s) of unknown directionality == | |
| − | {{#set: | + | {{#set: common-name=ubiquinol-8}} |
| − | {{#set: | + | {{#set: inchi-key=inchikey=lojuqfspyhmheo-sghxuwjisa-n}} |
| − | + | {{#set: molecular-weight=729.137}} | |
| − | {{#set: | ||
| − | |||
| − | |||
Latest revision as of 11:13, 18 March 2021
Contents
Metabolite CPD-9956
- common-name:
- ubiquinol-8
- smiles:
- cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c(o)=c(oc)c(oc)=c(o)c(c)=1)
- inchi-key:
- lojuqfspyhmheo-sghxuwjisa-n
- molecular-weight:
- 729.137
