Difference between revisions of "CPD-9957"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite Palmitoyl-lipid == * common-name: ** a [glycerolipid]-palmitate == Reaction(s) known to consume the compound == * RXN-16053 == Reacti...")
(Created page with "Category:metabolite == Metabolite CPD-9957 == * common-name: ** ubiquinol-9 * smiles: ** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c(o)=c(...")
 
(2 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite Palmitoyl-lipid ==
+
== Metabolite CPD-9957 ==
 
* common-name:
 
* common-name:
** a [glycerolipid]-palmitate
+
** ubiquinol-9
 +
* smiles:
 +
** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c(o)=c(oc)c(oc)=c(o)c(c)=1)
 +
* inchi-key:
 +
** npcoqxavbjjzbq-wjnluyjisa-n
 +
* molecular-weight:
 +
** 797.255
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-16053]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[2.1.1.64-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a [glycerolipid]-palmitate}}
+
{{#set: common-name=ubiquinol-9}}
 +
{{#set: inchi-key=inchikey=npcoqxavbjjzbq-wjnluyjisa-n}}
 +
{{#set: molecular-weight=797.255}}

Latest revision as of 11:17, 18 March 2021

Metabolite CPD-9957

  • common-name:
    • ubiquinol-9
  • smiles:
    • cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c(o)=c(oc)c(oc)=c(o)c(c)=1)
  • inchi-key:
    • npcoqxavbjjzbq-wjnluyjisa-n
  • molecular-weight:
    • 797.255

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality