Difference between revisions of "CPD-9957"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Reduced-cytochromes-c551 == * common-name: ** a reduced cytochrome c551 == Reaction(s) known to consume the compound == * RXN-15838 =...") |
(Created page with "Category:metabolite == Metabolite CPD-9957 == * common-name: ** ubiquinol-9 * smiles: ** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c(o)=c(...") |
||
(4 intermediate revisions by 3 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD-9957 == |
* common-name: | * common-name: | ||
− | ** | + | ** ubiquinol-9 |
+ | * smiles: | ||
+ | ** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c(o)=c(oc)c(oc)=c(o)c(c)=1) | ||
+ | * inchi-key: | ||
+ | ** npcoqxavbjjzbq-wjnluyjisa-n | ||
+ | * molecular-weight: | ||
+ | ** 797.255 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN | + | * [[2.1.1.64-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=ubiquinol-9}} |
+ | {{#set: inchi-key=inchikey=npcoqxavbjjzbq-wjnluyjisa-n}} | ||
+ | {{#set: molecular-weight=797.255}} |
Latest revision as of 11:17, 18 March 2021
Contents
Metabolite CPD-9957
- common-name:
- ubiquinol-9
- smiles:
- cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c(o)=c(oc)c(oc)=c(o)c(c)=1)
- inchi-key:
- npcoqxavbjjzbq-wjnluyjisa-n
- molecular-weight:
- 797.255