Difference between revisions of "CPD-9957"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=PHOSPHATIDYLCHOLINE-DESATURASE-RXN PHOSPHATIDYLCHOLINE-DESATURASE-RXN] == * direction: ** left-to-r...")
 
(Created page with "Category:metabolite == Metabolite CPD-9957 == * common-name: ** ubiquinol-9 * smiles: ** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c(o)=c(...")
 
(9 intermediate revisions by 5 users not shown)
Line 1: Line 1:
[[Category:reaction]]
+
[[Category:metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=PHOSPHATIDYLCHOLINE-DESATURASE-RXN PHOSPHATIDYLCHOLINE-DESATURASE-RXN] ==
+
== Metabolite CPD-9957 ==
* direction:
+
* common-name:
** left-to-right
+
** ubiquinol-9
* ec-number:
+
* smiles:
** [http://enzyme.expasy.org/EC/1.14.19.22 ec-1.14.19.22]
+
** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c(o)=c(oc)c(oc)=c(o)c(c)=1)
== Reaction formula ==
+
* inchi-key:
* 1 [[1-ACYL-2-OLEOYL-SN-GLYCERO-3-PHOSPHOCHOL]][c] '''+''' 2 [[FERROCYTOCHROME-B5]][c] '''+''' 1 [[OXYGEN-MOLECULE]][c] '''+''' 2 [[PROTON]][c] '''=>''' 1 [[1-ACYL-2-LINOLEOYL-SN-GLYCERO-3-PHOSPHOC]][c] '''+''' 2 [[FERRICYTOCHROME-B5]][c] '''+''' 2 [[WATER]][c]
+
** npcoqxavbjjzbq-wjnluyjisa-n
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
* Gene: [[SJ00667]]
+
** 797.255
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
== Reaction(s) known to produce the compound ==
== Pathway(s) ==
+
* [[2.1.1.64-RXN]]
== Reconstruction information  ==
+
== Reaction(s) of unknown directionality ==
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: common-name=ubiquinol-9}}
== External links  ==
+
{{#set: inchi-key=inchikey=npcoqxavbjjzbq-wjnluyjisa-n}}
* RHEA:
+
{{#set: molecular-weight=797.255}}
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=12564 12564]
 
* LIGAND-RXN:
 
** [http://www.genome.jp/dbget-bin/www_bget?R03475 R03475]
 
* UNIPROT:
 
** [http://www.uniprot.org/uniprot/P20388 P20388]
 
** [http://www.uniprot.org/uniprot/Q55230 Q55230]
 
** [http://www.uniprot.org/uniprot/Q55231 Q55231]
 
** [http://www.uniprot.org/uniprot/Q44503 Q44503]
 
{{#set: direction=left-to-right}}
 
{{#set: ec-number=ec-1.14.19.22}}
 
{{#set: nb gene associated=1}}
 
{{#set: nb pathway associated=0}}
 
{{#set: reconstruction category=annotation}}
 
{{#set: reconstruction tool=pathwaytools}}
 
{{#set: reconstruction comment=n.a}}
 
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Latest revision as of 11:17, 18 March 2021

Metabolite CPD-9957

  • common-name:
    • ubiquinol-9
  • smiles:
    • cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c(o)=c(oc)c(oc)=c(o)c(c)=1)
  • inchi-key:
    • npcoqxavbjjzbq-wjnluyjisa-n
  • molecular-weight:
    • 797.255

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality