Difference between revisions of "CPD-9965"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-3723 == * common-name: ** uridine 2'-monophosphate * smiles: ** c(o)c1(oc(c(op(=o)([o-])[o-])c(o)1)n2(c=cc(=o)nc(=o)2)) * inchi-key:...")
(Created page with "Category:metabolite == Metabolite CPD-9965 == * common-name: ** icosanoyl-coa * smiles: ** cccccccccccccccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-...")
 
(3 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-3723 ==
+
== Metabolite CPD-9965 ==
 
* common-name:
 
* common-name:
** uridine 2'-monophosphate
+
** icosanoyl-coa
 
* smiles:
 
* smiles:
** c(o)c1(oc(c(op(=o)([o-])[o-])c(o)1)n2(c=cc(=o)nc(=o)2))
+
** cccccccccccccccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
* inchi-key:
** hqidpeytetucnf-xvfcmesisa-l
+
** jylsvnbjlycssw-ibyujnrcsa-j
 
* molecular-weight:
 
* molecular-weight:
** 322.168
+
** 1058.022
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-13295]]
 +
* [[RXN-9356]]
 +
* [[RXN-9629]]
 +
* [[RXN1G-460]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-12060]]
+
* [[RXN-9356]]
 +
* [[RXN1G-460]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=uridine 2'-monophosphate}}
+
{{#set: common-name=icosanoyl-coa}}
{{#set: inchi-key=inchikey=hqidpeytetucnf-xvfcmesisa-l}}
+
{{#set: inchi-key=inchikey=jylsvnbjlycssw-ibyujnrcsa-j}}
{{#set: molecular-weight=322.168}}
+
{{#set: molecular-weight=1058.022}}

Latest revision as of 11:11, 18 March 2021

Metabolite CPD-9965

  • common-name:
    • icosanoyl-coa
  • smiles:
    • cccccccccccccccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • jylsvnbjlycssw-ibyujnrcsa-j
  • molecular-weight:
    • 1058.022

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality