Difference between revisions of "CPD-9965"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-3723 == * common-name: ** uridine 2'-monophosphate * smiles: ** c(o)c1(oc(c(op(=o)([o-])[o-])c(o)1)n2(c=cc(=o)nc(=o)2)) * inchi-key:...") |
(Created page with "Category:metabolite == Metabolite CPD-479 == * common-name: ** 4-(methylsulfanyl)-2-oxobutanoate * smiles: ** csccc(c([o-])=o)=o * inchi-key: ** sxfsqzdsuwackx-uhfffaoysa-...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite CPD- | + | == Metabolite CPD-479 == |
* common-name: | * common-name: | ||
− | ** | + | ** 4-(methylsulfanyl)-2-oxobutanoate |
* smiles: | * smiles: | ||
− | ** | + | ** csccc(c([o-])=o)=o |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** sxfsqzdsuwackx-uhfffaoysa-m |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 147.168 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[RXN-14147]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[R147-RXN]] |
+ | * [[RXN-14147]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=4-(methylsulfanyl)-2-oxobutanoate}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=sxfsqzdsuwackx-uhfffaoysa-m}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=147.168}} |
Revision as of 18:53, 14 January 2021
Contents
Metabolite CPD-479
- common-name:
- 4-(methylsulfanyl)-2-oxobutanoate
- smiles:
- csccc(c([o-])=o)=o
- inchi-key:
- sxfsqzdsuwackx-uhfffaoysa-m
- molecular-weight:
- 147.168