Difference between revisions of "CPD0-1028"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 3R-9Z-3-hydroxy-octadec-9-enoyl-ACPs == * common-name: ** a (3r,9z)-3-hydroxy-octadec-9-enoyl-[acp] == Reaction(s) known to consume the c...")
(Created page with "Category:metabolite == Metabolite CPD0-1028 == * common-name: ** 2-cis,6-trans,10-trans-geranylgeranyl diphosphate * smiles: ** cc(=cccc(c)=cccc(c)=cccc(c)=ccop([o-])(=o)o...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 3R-9Z-3-hydroxy-octadec-9-enoyl-ACPs ==
+
== Metabolite CPD0-1028 ==
 
* common-name:
 
* common-name:
** a (3r,9z)-3-hydroxy-octadec-9-enoyl-[acp]
+
** 2-cis,6-trans,10-trans-geranylgeranyl diphosphate
 +
* smiles:
 +
** cc(=cccc(c)=cccc(c)=cccc(c)=ccop([o-])(=o)op(=o)([o-])[o-])c
 +
* inchi-key:
 +
** oinneunvozhbox-kwbdajkesa-k
 +
* molecular-weight:
 +
** 447.424
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-16627]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-16626]]
+
* [[RXN0-5180]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a (3r,9z)-3-hydroxy-octadec-9-enoyl-[acp]}}
+
{{#set: common-name=2-cis,6-trans,10-trans-geranylgeranyl diphosphate}}
 +
{{#set: inchi-key=inchikey=oinneunvozhbox-kwbdajkesa-k}}
 +
{{#set: molecular-weight=447.424}}

Latest revision as of 11:16, 18 March 2021

Metabolite CPD0-1028

  • common-name:
    • 2-cis,6-trans,10-trans-geranylgeranyl diphosphate
  • smiles:
    • cc(=cccc(c)=cccc(c)=cccc(c)=ccop([o-])(=o)op(=o)([o-])[o-])c
  • inchi-key:
    • oinneunvozhbox-kwbdajkesa-k
  • molecular-weight:
    • 447.424

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality