|
|
| (7 intermediate revisions by 3 users not shown) |
| Line 1: |
Line 1: |
| − | [[Category:reaction]] | + | [[Category:metabolite]] |
| − | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ALCOHOL-DEHYDROG-RXN ALCOHOL-DEHYDROG-RXN] == | + | == Metabolite CPD0-1028 == |
| − | * direction:
| |
| − | ** reversible
| |
| | * common-name: | | * common-name: |
| − | ** alcohol dehydrogenase (nad) | + | ** 2-cis,6-trans,10-trans-geranylgeranyl diphosphate |
| − | ** alcohol dehydrogenase
| + | * smiles: |
| − | * ec-number:
| + | ** cc(=cccc(c)=cccc(c)=cccc(c)=ccop([o-])(=o)op(=o)([o-])[o-])c |
| − | ** [http://enzyme.expasy.org/EC/1.1.1.1 ec-1.1.1.1]
| + | * inchi-key: |
| − | == Reaction formula ==
| + | ** oinneunvozhbox-kwbdajkesa-k |
| − | * 1 [[ETOH]][c] '''+''' 1 [[NAD]][c] '''<=>''' 1 [[ACETALD]][c] '''+''' 1 [[NADH]][c] '''+''' 1 [[PROTON]][c]
| + | * molecular-weight: |
| − | == Gene(s) associated with this reaction ==
| + | ** 447.424 |
| − | * Gene: [[SJ07759]]
| + | == Reaction(s) known to consume the compound == |
| − | ** Category: [[annotation]]
| + | == Reaction(s) known to produce the compound == |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
| + | * [[RXN0-5180]] |
| − | * Gene: [[SJ21601]]
| + | == Reaction(s) of unknown directionality == |
| − | ** Category: [[annotation]]
| + | {{#set: common-name=2-cis,6-trans,10-trans-geranylgeranyl diphosphate}} |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
| + | {{#set: inchi-key=inchikey=oinneunvozhbox-kwbdajkesa-k}} |
| − | * Gene: [[SJ14768]] | + | {{#set: molecular-weight=447.424}} |
| − | ** Category: [[annotation]] | |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
| |
| − | == Pathway(s) == | |
| − | <div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
| |
| − | * [[PWY-6587]], pyruvate fermentation to ethanol III: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6587 PWY-6587]
| |
| − | ** '''2''' reactions found over '''3''' reactions in the full pathway
| |
| − | * [[PWY-5480]], pyruvate fermentation to ethanol I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5480 PWY-5480]
| |
| − | ** '''1''' reactions found over '''3''' reactions in the full pathway
| |
| − | * [[P161-PWY]], acetylene degradation (anaerobic): [http://metacyc.org/META/NEW-IMAGE?object=P161-PWY P161-PWY]
| |
| − | ** '''2''' reactions found over '''5''' reactions in the full pathway | |
| − | * [[FERMENTATION-PWY]], mixed acid fermentation: [http://metacyc.org/META/NEW-IMAGE?object=FERMENTATION-PWY FERMENTATION-PWY]
| |
| − | ** '''11''' reactions found over '''16''' reactions in the full pathway | |
| − | * [[PWY-6333]], acetaldehyde biosynthesis I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6333 PWY-6333]
| |
| − | ** '''1''' reactions found over '''1''' reactions in the full pathway | |
| − | * [[PWY-5486]], pyruvate fermentation to ethanol II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5486 PWY-5486]
| |
| − | ** '''1''' reactions found over '''2''' reactions in the full pathway | |
| − | * [[P122-PWY]], heterolactic fermentation: [http://metacyc.org/META/NEW-IMAGE?object=P122-PWY P122-PWY]
| |
| − | ** '''16''' reactions found over '''18''' reactions in the full pathway
| |
| − | * [[PWY66-21]], ethanol degradation II: [http://metacyc.org/META/NEW-IMAGE?object=PWY66-21 PWY66-21]
| |
| − | ** '''3''' reactions found over '''3''' reactions in the full pathway
| |
| − | * [[ETOH-ACETYLCOA-ANA-PWY]], ethanol degradation I: [http://metacyc.org/META/NEW-IMAGE?object=ETOH-ACETYLCOA-ANA-PWY ETOH-ACETYLCOA-ANA-PWY]
| |
| − | ** '''1''' reactions found over '''2''' reactions in the full pathway
| |
| − | * [[PWY4LZ-257]], superpathway of fermentation (Chlamydomonas reinhardtii): [http://metacyc.org/META/NEW-IMAGE?object=PWY4LZ-257 PWY4LZ-257]
| |
| − | ** '''7''' reactions found over '''7''' reactions in the full pathway
| |
| − | * [[PWY-7118]], chitin degradation to ethanol: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7118 PWY-7118]
| |
| − | ** '''5''' reactions found over '''6''' reactions in the full pathway
| |
| − | </div>
| |
| − | == Reconstruction information == | |
| − | * category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a | |
| − | == External links == | |
| − | * RHEA:
| |
| − | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=25293 25293]
| |
| − | * LIGAND-RXN:
| |
| − | ** [http://www.genome.jp/dbget-bin/www_bget?R00754 R00754]
| |
| − | {{#set: direction=reversible}}
| |
| − | {{#set: common-name=alcohol dehydrogenase (nad)|alcohol dehydrogenase}} | |
| − | {{#set: ec-number=ec-1.1.1.1}}
| |
| − | {{#set: nb gene associated=3}} | |
| − | {{#set: nb pathway associated=11}}
| |
| − | {{#set: reconstruction category=annotation}} | |
| − | {{#set: reconstruction tool=pathwaytools}}
| |
| − | {{#set: reconstruction comment=n.a}}
| |
| − | {{#set: reconstruction source=saccharina_japonica_genome}}
| |
