Difference between revisions of "CPD0-1028"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Arachidoyl-ACPs == * common-name: ** an arachidoyl-[acp] == Reaction(s) known to consume the compound == * RXN1G-445 == Reaction(s) k...") |
(Created page with "Category:metabolite == Metabolite CPD0-1028 == * common-name: ** 2-cis,6-trans,10-trans-geranylgeranyl diphosphate * smiles: ** cc(=cccc(c)=cccc(c)=cccc(c)=ccop([o-])(=o)o...") |
||
| (6 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD0-1028 == |
* common-name: | * common-name: | ||
| − | ** | + | ** 2-cis,6-trans,10-trans-geranylgeranyl diphosphate |
| + | * smiles: | ||
| + | ** cc(=cccc(c)=cccc(c)=cccc(c)=ccop([o-])(=o)op(=o)([o-])[o-])c | ||
| + | * inchi-key: | ||
| + | ** oinneunvozhbox-kwbdajkesa-k | ||
| + | * molecular-weight: | ||
| + | ** 447.424 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN0-5180]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=2-cis,6-trans,10-trans-geranylgeranyl diphosphate}} |
| + | {{#set: inchi-key=inchikey=oinneunvozhbox-kwbdajkesa-k}} | ||
| + | {{#set: molecular-weight=447.424}} | ||
Latest revision as of 11:16, 18 March 2021
Contents
Metabolite CPD0-1028
- common-name:
- 2-cis,6-trans,10-trans-geranylgeranyl diphosphate
- smiles:
- cc(=cccc(c)=cccc(c)=cccc(c)=ccop([o-])(=o)op(=o)([o-])[o-])c
- inchi-key:
- oinneunvozhbox-kwbdajkesa-k
- molecular-weight:
- 447.424
