Difference between revisions of "CPD0-1028"
Jump to navigation
Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14992 RXN-14992] == * direction: ** left-to-right * common-name: ** protein-(glutamine-n5) meth...") |
(Created page with "Category:metabolite == Metabolite CPD0-1028 == * common-name: ** 2-cis,6-trans,10-trans-geranylgeranyl diphosphate * smiles: ** cc(=cccc(c)=cccc(c)=cccc(c)=ccop([o-])(=o)o...") |
||
(9 intermediate revisions by 5 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite CPD0-1028 == |
− | |||
− | |||
* common-name: | * common-name: | ||
− | ** | + | ** 2-cis,6-trans,10-trans-geranylgeranyl diphosphate |
− | * | + | * smiles: |
− | ** | + | ** cc(=cccc(c)=cccc(c)=cccc(c)=ccop([o-])(=o)op(=o)([o-])[o-])c |
− | == | + | * inchi-key: |
− | + | ** oinneunvozhbox-kwbdajkesa-k | |
− | + | * molecular-weight: | |
− | * | + | ** 447.424 |
− | ** | + | == Reaction(s) known to consume the compound == |
− | * | + | == Reaction(s) known to produce the compound == |
− | + | * [[RXN0-5180]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | ** | + | {{#set: common-name=2-cis,6-trans,10-trans-geranylgeranyl diphosphate}} |
− | == | + | {{#set: inchi-key=inchikey=oinneunvozhbox-kwbdajkesa-k}} |
− | == | + | {{#set: molecular-weight=447.424}} |
− | * | ||
− | == | ||
− | |||
− | |||
− | |||
− | {{#set: common-name= | ||
− | |||
− | {{#set: | ||
− | |||
− | {{#set: | ||
− | |||
− | |||
− |
Latest revision as of 11:16, 18 March 2021
Contents
Metabolite CPD0-1028
- common-name:
- 2-cis,6-trans,10-trans-geranylgeranyl diphosphate
- smiles:
- cc(=cccc(c)=cccc(c)=cccc(c)=ccop([o-])(=o)op(=o)([o-])[o-])c
- inchi-key:
- oinneunvozhbox-kwbdajkesa-k
- molecular-weight:
- 447.424