Difference between revisions of "CPD0-1065"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite PSEUDOURIDINE-5-P == * common-name: ** pseudouridine 5'-phosphate * smiles: ** c1(nc(=o)nc(=o)c=1c2(oc(cop(=o)([o-])[o-])c(o)c(o)2)) * in...") |
(Created page with "Category:metabolite == Metabolite 25S-rRNA-adenine-645 == * common-name: ** adenine645 in 25s rrna == Reaction(s) known to consume the compound == * RXN-14550 == React...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite 25S-rRNA-adenine-645 == |
* common-name: | * common-name: | ||
− | ** | + | ** adenine645 in 25s rrna |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[RXN-14550]] |
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
− | |||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=adenine645 in 25s rrna}} |
− | |||
− |
Revision as of 13:08, 14 January 2021
Contents
Metabolite 25S-rRNA-adenine-645
- common-name:
- adenine645 in 25s rrna