Difference between revisions of "CPD0-1065"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite PSEUDOURIDINE-5-P == * common-name: ** pseudouridine 5'-phosphate * smiles: ** c1(nc(=o)nc(=o)c=1c2(oc(cop(=o)([o-])[o-])c(o)c(o)2)) * in...")
(Created page with "Category:metabolite == Metabolite 25S-rRNA-adenine-645 == * common-name: ** adenine645 in 25s rrna == Reaction(s) known to consume the compound == * RXN-14550 == React...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite PSEUDOURIDINE-5-P ==
+
== Metabolite 25S-rRNA-adenine-645 ==
 
* common-name:
 
* common-name:
** pseudouridine 5'-phosphate
+
** adenine645 in 25s rrna
* smiles:
 
** c1(nc(=o)nc(=o)c=1c2(oc(cop(=o)([o-])[o-])c(o)c(o)2))
 
* inchi-key:
 
** mobmojgxnhllir-gbndhiklsa-l
 
* molecular-weight:
 
** 322.168
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-15703]]
+
* [[RXN-14550]]
* [[RXN0-5398]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[PSEUDOURIDINE-KINASE-RXN]]
 
* [[RXN-15703]]
 
* [[RXN0-5398]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=pseudouridine 5'-phosphate}}
+
{{#set: common-name=adenine645 in 25s rrna}}
{{#set: inchi-key=inchikey=mobmojgxnhllir-gbndhiklsa-l}}
 
{{#set: molecular-weight=322.168}}
 

Revision as of 13:08, 14 January 2021

Metabolite 25S-rRNA-adenine-645

  • common-name:
    • adenine645 in 25s rrna

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality