Difference between revisions of "CPD0-1107"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-15838 RXN-15838] == * direction: ** reversible * common-name: ** nitrite reductase (no-forming)...")
(Created page with "Category:metabolite == Metabolite CPD-824 == * common-name: ** 5-guanidino-2-oxopentanoate * smiles: ** c(c(cccnc(=[n+])n)=o)(=o)[o-] * inchi-key: ** arbhxjxxvvhmet-uhfffa...")
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-15838 RXN-15838] ==
+
== Metabolite CPD-824 ==
−
* direction:
 
−
** reversible
 
 
* common-name:
 
* common-name:
−
** nitrite reductase (no-forming)
+
** 5-guanidino-2-oxopentanoate
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/1.7.2.1 ec-1.7.2.1]
+
** c(c(cccnc(=[n+])n)=o)(=o)[o-]
−
== Reaction formula ==
+
* inchi-key:
−
* 1 [[NITRITE]][e] '''+''' 2 [[PROTON]][e] '''+''' 1 [[Reduced-cytochromes-c551]][e] '''<=>''' 1 [[NITRIC-OXIDE]][e] '''+''' 1 [[Oxidized-cytochromes-c551]][e] '''+''' 1 [[WATER]][e]
+
** arbhxjxxvvhmet-uhfffaoysa-n
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
* Gene: [[SJ15937]]
+
** 173.171
−
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
+
== Reaction(s) known to produce the compound ==
−
== Pathway(s) ==
+
* [[ARG-OXIDATION-RXN]]
−
* [[DENITRIFICATION-PWY]], nitrate reduction I (denitrification): [http://metacyc.org/META/NEW-IMAGE?object=DENITRIFICATION-PWY DENITRIFICATION-PWY]
+
== Reaction(s) of unknown directionality ==
−
** '''1''' reactions found over '''5''' reactions in the full pathway
+
{{#set: common-name=5-guanidino-2-oxopentanoate}}
−
== Reconstruction information  ==
+
{{#set: inchi-key=inchikey=arbhxjxxvvhmet-uhfffaoysa-n}}
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: molecular-weight=173.171}}
−
== External links  ==
 
−
{{#set: direction=reversible}}
 
−
{{#set: common-name=nitrite reductase (no-forming)}}
 
−
{{#set: ec-number=ec-1.7.2.1}}
 
−
{{#set: nb gene associated=1}}
 
−
{{#set: nb pathway associated=1}}
 
−
{{#set: reconstruction category=annotation}}
 
−
{{#set: reconstruction tool=pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Revision as of 20:37, 18 December 2020

Metabolite CPD-824

  • common-name:
    • 5-guanidino-2-oxopentanoate
  • smiles:
    • c(c(cccnc(=[n+])n)=o)(=o)[o-]
  • inchi-key:
    • arbhxjxxvvhmet-uhfffaoysa-n
  • molecular-weight:
    • 173.171

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD0-1107&oldid=48214"