Difference between revisions of "CPD0-1133"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ02226 == * transcription-direction: ** negative * right-end-position: ** 115592 * left-end-position: ** 114978 * centisome-position: ** 82.185265...")
(Created page with "Category:metabolite == Metabolite CPD0-1133 == * common-name: ** maltoheptaose * smiles: ** c(o)c1(c(o)c(o)c(o)c(o1)oc2(c(o)c(o)c(oc(co)2)oc3(c(o)c(o)c(oc(co)3)oc7(c(o)c(o...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
[[Category:gene]]
+
[[Category:metabolite]]
== Gene SJ02226 ==
+
== Metabolite CPD0-1133 ==
* transcription-direction:
+
* common-name:
** negative
+
** maltoheptaose
* right-end-position:
+
* smiles:
** 115592
+
** c(o)c1(c(o)c(o)c(o)c(o1)oc2(c(o)c(o)c(oc(co)2)oc3(c(o)c(o)c(oc(co)3)oc7(c(o)c(o)c(oc6(c(o)c(o)c(oc4(c(o)c(o)c(oc(co)4)oc5(c(o)c(o)c(o)oc(co)5)))oc(co)6))oc(co)7))))
* left-end-position:
+
* inchi-key:
** 114978
+
** bnabbhgyymzmoa-qjbbzcpbsa-n
* centisome-position:
+
* molecular-weight:
** 82.185265   
+
** 1153.009
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
* [[S.japonica_carotenoid_curated]]
+
* [[RXN-14283]]
== Reaction(s) associated ==
+
* [[RXN-14286]]
* [[RNA-DIRECTED-DNA-POLYMERASE-RXN]]
+
== Reaction(s) known to produce the compound ==
** Category: [[annotation]]
+
== Reaction(s) of unknown directionality ==
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: common-name=maltoheptaose}}
{{#set: transcription-direction=negative}}
+
{{#set: inchi-key=inchikey=bnabbhgyymzmoa-qjbbzcpbsa-n}}
{{#set: right-end-position=115592}}
+
{{#set: molecular-weight=1153.009}}
{{#set: left-end-position=114978}}
 
{{#set: centisome-position=82.185265    }}
 
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
{{#set: nb reaction associated=1}}
 

Latest revision as of 11:11, 18 March 2021

Metabolite CPD0-1133

  • common-name:
    • maltoheptaose
  • smiles:
    • c(o)c1(c(o)c(o)c(o)c(o1)oc2(c(o)c(o)c(oc(co)2)oc3(c(o)c(o)c(oc(co)3)oc7(c(o)c(o)c(oc6(c(o)c(o)c(oc4(c(o)c(o)c(oc(co)4)oc5(c(o)c(o)c(o)oc(co)5)))oc(co)6))oc(co)7))))
  • inchi-key:
    • bnabbhgyymzmoa-qjbbzcpbsa-n
  • molecular-weight:
    • 1153.009

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality