Difference between revisions of "CPD0-1133"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite N-terminal-L-alanine == * common-name: ** an n-terminal l-alanyl-[protein] == Reaction(s) known to consume the compound == == Reaction(s)...")
(Created page with "Category:metabolite == Metabolite CPD0-1133 == * common-name: ** maltoheptaose * smiles: ** c(o)c1(c(o)c(o)c(o)c(o1)oc2(c(o)c(o)c(oc(co)2)oc3(c(o)c(o)c(oc(co)3)oc7(c(o)c(o...")
 
(4 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite N-terminal-L-alanine ==
+
== Metabolite CPD0-1133 ==
 
* common-name:
 
* common-name:
** an n-terminal l-alanyl-[protein]
+
** maltoheptaose
 +
* smiles:
 +
** c(o)c1(c(o)c(o)c(o)c(o1)oc2(c(o)c(o)c(oc(co)2)oc3(c(o)c(o)c(oc(co)3)oc7(c(o)c(o)c(oc6(c(o)c(o)c(oc4(c(o)c(o)c(oc(co)4)oc5(c(o)c(o)c(o)oc(co)5)))oc(co)6))oc(co)7))))
 +
* inchi-key:
 +
** bnabbhgyymzmoa-qjbbzcpbsa-n
 +
* molecular-weight:
 +
** 1153.009
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-14283]]
 +
* [[RXN-14286]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-17873]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=an n-terminal l-alanyl-[protein]}}
+
{{#set: common-name=maltoheptaose}}
 +
{{#set: inchi-key=inchikey=bnabbhgyymzmoa-qjbbzcpbsa-n}}
 +
{{#set: molecular-weight=1153.009}}

Latest revision as of 11:11, 18 March 2021

Metabolite CPD0-1133

  • common-name:
    • maltoheptaose
  • smiles:
    • c(o)c1(c(o)c(o)c(o)c(o1)oc2(c(o)c(o)c(oc(co)2)oc3(c(o)c(o)c(oc(co)3)oc7(c(o)c(o)c(oc6(c(o)c(o)c(oc4(c(o)c(o)c(oc(co)4)oc5(c(o)c(o)c(o)oc(co)5)))oc(co)6))oc(co)7))))
  • inchi-key:
    • bnabbhgyymzmoa-qjbbzcpbsa-n
  • molecular-weight:
    • 1153.009

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality