Difference between revisions of "CPD0-1133"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CHOLESTEROL == * common-name: ** cholesterol * smiles: ** cc(c)cccc(c)[ch]3(cc[ch]4([ch]2(cc=c1(cc(o)ccc(c)1[ch]2ccc(c)34)))) * inchi-key...")
(Created page with "Category:metabolite == Metabolite CPD0-1133 == * common-name: ** maltoheptaose * smiles: ** c(o)c1(c(o)c(o)c(o)c(o1)oc2(c(o)c(o)c(oc(co)2)oc3(c(o)c(o)c(oc(co)3)oc7(c(o)c(o...")
 
(3 intermediate revisions by one other user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CHOLESTEROL ==
+
== Metabolite CPD0-1133 ==
 
* common-name:
 
* common-name:
** cholesterol
+
** maltoheptaose
 
* smiles:
 
* smiles:
** cc(c)cccc(c)[ch]3(cc[ch]4([ch]2(cc=c1(cc(o)ccc(c)1[ch]2ccc(c)34))))
+
** c(o)c1(c(o)c(o)c(o)c(o1)oc2(c(o)c(o)c(oc(co)2)oc3(c(o)c(o)c(oc(co)3)oc7(c(o)c(o)c(oc6(c(o)c(o)c(oc4(c(o)c(o)c(oc(co)4)oc5(c(o)c(o)c(o)oc(co)5)))oc(co)6))oc(co)7))))
 
* inchi-key:
 
* inchi-key:
** hvywmomldimfja-dpaqbdifsa-n
+
** bnabbhgyymzmoa-qjbbzcpbsa-n
 
* molecular-weight:
 
* molecular-weight:
** 386.66
+
** 1153.009
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[1.14.99.38-RXN]]
+
* [[RXN-14283]]
* [[RXN-12127]]
+
* [[RXN-14286]]
* [[RXN-12693]]
 
* [[RXN-12701]]
 
* [[RXN-17655]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-12693]]
 
* [[RXN66-28]]
 
* [[RXN66-323]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=cholesterol}}
+
{{#set: common-name=maltoheptaose}}
{{#set: inchi-key=inchikey=hvywmomldimfja-dpaqbdifsa-n}}
+
{{#set: inchi-key=inchikey=bnabbhgyymzmoa-qjbbzcpbsa-n}}
{{#set: molecular-weight=386.66}}
+
{{#set: molecular-weight=1153.009}}

Latest revision as of 11:11, 18 March 2021

Metabolite CPD0-1133

  • common-name:
    • maltoheptaose
  • smiles:
    • c(o)c1(c(o)c(o)c(o)c(o1)oc2(c(o)c(o)c(oc(co)2)oc3(c(o)c(o)c(oc(co)3)oc7(c(o)c(o)c(oc6(c(o)c(o)c(oc4(c(o)c(o)c(oc(co)4)oc5(c(o)c(o)c(o)oc(co)5)))oc(co)6))oc(co)7))))
  • inchi-key:
    • bnabbhgyymzmoa-qjbbzcpbsa-n
  • molecular-weight:
    • 1153.009

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality