Difference between revisions of "CPD0-1162"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 5-DIPHOSPHO-1D-MYO-INOSITOL-12346P == * common-name: ** 1d-myoinositol 5-diphosphate 1,2,3,4,6-pentakisphosphate * smiles: ** c1(op([o-])...")
(Created page with "Category:metabolite == Metabolite CPD0-1162 == * common-name: ** (2e,5z)-tetradecenoyl-coa * smiles: ** ccccccccc=ccc=cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(...")
 
(4 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 5-DIPHOSPHO-1D-MYO-INOSITOL-12346P ==
+
== Metabolite CPD0-1162 ==
 
* common-name:
 
* common-name:
** 1d-myoinositol 5-diphosphate 1,2,3,4,6-pentakisphosphate
+
** (2e,5z)-tetradecenoyl-coa
 
* smiles:
 
* smiles:
** c1(op([o-])([o-])=o)(c(op([o-])([o-])=o)c(op([o-])(=o)[o-])c(op([o-])(=o)op([o-])(=o)[o-])c(op(=o)([o-])[o-])c(op(=o)([o-])[o-])1)
+
** ccccccccc=ccc=cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
 
* inchi-key:
 
* inchi-key:
** uphpwxpnziozjl-kxxvrosksa-a
+
** jvefyxpcqbmmaa-zmlwrgbosa-j
 
* molecular-weight:
 
* molecular-weight:
** 726.913
+
** 969.83
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[2.7.4.24-RXN]]
+
* [[RXN0-5393]]
* [[RXN-10964]]
 
* [[RXN-10965]]
 
* [[RXN-10979]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[2.7.1.152-RXN]]
+
* [[RXN-14576]]
* [[RXN-10965]]
+
* [[RXN-17783]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=1d-myoinositol 5-diphosphate 1,2,3,4,6-pentakisphosphate}}
+
{{#set: common-name=(2e,5z)-tetradecenoyl-coa}}
{{#set: inchi-key=inchikey=uphpwxpnziozjl-kxxvrosksa-a}}
+
{{#set: inchi-key=inchikey=jvefyxpcqbmmaa-zmlwrgbosa-j}}
{{#set: molecular-weight=726.913}}
+
{{#set: molecular-weight=969.83}}

Latest revision as of 11:13, 18 March 2021

Metabolite CPD0-1162

  • common-name:
    • (2e,5z)-tetradecenoyl-coa
  • smiles:
    • ccccccccc=ccc=cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
  • inchi-key:
    • jvefyxpcqbmmaa-zmlwrgbosa-j
  • molecular-weight:
    • 969.83

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality