Difference between revisions of "CPD0-1308"
Jump to navigation
Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12894 RXN-12894] == * direction: ** left-to-right * ec-number: ** [http://enzyme.expasy.org/EC/...") |
(Created page with "Category:metabolite == Metabolite CPD0-1308 == * common-name: ** glyphosate * smiles: ** c(ncc(=o)[o-])p(o)([o-])=o * inchi-key: ** xddaorkbjwwyjs-uhfffaoysa-l * molecular...") |
||
(7 intermediate revisions by 3 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite CPD0-1308 == |
− | * | + | * common-name: |
− | ** | + | ** glyphosate |
− | * | + | * smiles: |
− | ** | + | ** c(ncc(=o)[o-])p(o)([o-])=o |
− | + | * inchi-key: | |
− | + | ** xddaorkbjwwyjs-uhfffaoysa-l | |
− | + | * molecular-weight: | |
− | * | + | ** 167.058 |
− | ** | + | == Reaction(s) known to consume the compound == |
− | ** | + | * [[RXN-17951]] |
− | == | + | == Reaction(s) known to produce the compound == |
− | + | == Reaction(s) of unknown directionality == | |
− | * | + | {{#set: common-name=glyphosate}} |
− | == | + | {{#set: inchi-key=inchikey=xddaorkbjwwyjs-uhfffaoysa-l}} |
− | + | {{#set: molecular-weight=167.058}} | |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | {{#set: | ||
− | {{#set: | ||
− | |||
− | {{#set: | ||
− |
Latest revision as of 11:17, 18 March 2021
Contents
Metabolite CPD0-1308
- common-name:
- glyphosate
- smiles:
- c(ncc(=o)[o-])p(o)([o-])=o
- inchi-key:
- xddaorkbjwwyjs-uhfffaoysa-l
- molecular-weight:
- 167.058