Difference between revisions of "CPD0-1445"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite VANILLYL_MANDELATE == * common-name: ** vanillyl mandelate * smiles: ** coc1(c(o)=cc=c(c=1)c(o)c(=o)[o-]) * inchi-key: ** cgqcwmiaepehnq-...") |
(Created page with "Category:metabolite == Metabolite CPD-14283 == * common-name: ** trans-cerot-2-enoyl-coa * smiles: ** cccccccccccccccccccccccc=cc(=o)sccnc(=o)ccnc(c(o)c(c)(c)cop([o-])(=o)...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD-14283 == |
* common-name: | * common-name: | ||
− | ** | + | ** trans-cerot-2-enoyl-coa |
* smiles: | * smiles: | ||
− | ** | + | ** cccccccccccccccccccccccc=cc(=o)sccnc(=o)ccnc(c(o)c(c)(c)cop([o-])(=o)op([o-])(=o)occ1(c(op(=o)([o-])[o-])c(o)c(o1)n3(c=nc2(c(n)=nc=nc=23))))=o |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** gguuxbbwtgiige-kesudtcvsa-j |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 1140.167 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[RXN-13305]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=trans-cerot-2-enoyl-coa}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=gguuxbbwtgiige-kesudtcvsa-j}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=1140.167}} |
Revision as of 15:26, 5 January 2021
Contents
Metabolite CPD-14283
- common-name:
- trans-cerot-2-enoyl-coa
- smiles:
- cccccccccccccccccccccccc=cc(=o)sccnc(=o)ccnc(c(o)c(c)(c)cop([o-])(=o)op([o-])(=o)occ1(c(op(=o)([o-])[o-])c(o)c(o1)n3(c=nc2(c(n)=nc=nc=23))))=o
- inchi-key:
- gguuxbbwtgiige-kesudtcvsa-j
- molecular-weight:
- 1140.167