Difference between revisions of "CPD0-1445"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite O-ACETYLCARNITINE == * common-name: ** o-acetyl-l-carnitine * smiles: ** cc(=o)oc(cc(=o)[o-])c[n+](c)(c)c * inchi-key: ** rdhqfkqigngied-...")
(Created page with "Category:metabolite == Metabolite CIS-ACONITATE == * common-name: ** cis-aconitate * smiles: ** c([o-])(=o)c(=cc(=o)[o-])cc(=o)[o-] * inchi-key: ** gtzcvfvgugfeme-iwqzzhsr...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite O-ACETYLCARNITINE ==
+
== Metabolite CIS-ACONITATE ==
 
* common-name:
 
* common-name:
** o-acetyl-l-carnitine
+
** cis-aconitate
 
* smiles:
 
* smiles:
** cc(=o)oc(cc(=o)[o-])c[n+](c)(c)c
+
** c([o-])(=o)c(=cc(=o)[o-])cc(=o)[o-]
 
* inchi-key:
 
* inchi-key:
** rdhqfkqigngied-mrvpvssysa-n
+
** gtzcvfvgugfeme-iwqzzhsrsa-k
 
* molecular-weight:
 
* molecular-weight:
** 203.238
+
** 171.086
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[CARNITINE-O-ACETYLTRANSFERASE-RXN]]
+
* [[ACONITATEDEHYDR-RXN]]
 +
* [[ACONITATEHYDR-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[CARNITINE-O-ACETYLTRANSFERASE-RXN]]
+
* [[ACONITATEDEHYDR-RXN]]
 +
* [[ACONITATEHYDR-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=o-acetyl-l-carnitine}}
+
{{#set: common-name=cis-aconitate}}
{{#set: inchi-key=inchikey=rdhqfkqigngied-mrvpvssysa-n}}
+
{{#set: inchi-key=inchikey=gtzcvfvgugfeme-iwqzzhsrsa-k}}
{{#set: molecular-weight=203.238}}
+
{{#set: molecular-weight=171.086}}

Revision as of 18:54, 14 January 2021

Metabolite CIS-ACONITATE

  • common-name:
    • cis-aconitate
  • smiles:
    • c([o-])(=o)c(=cc(=o)[o-])cc(=o)[o-]
  • inchi-key:
    • gtzcvfvgugfeme-iwqzzhsrsa-k
  • molecular-weight:
    • 171.086

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality