Difference between revisions of "CPD0-1718"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ02816 == * transcription-direction: ** positive * right-end-position: ** 908096 * left-end-position: ** 902717 * centisome-position: ** 83.21867...")
 
(Created page with "Category:metabolite == Metabolite CPD0-1718 == * common-name: ** 7,8-dihydropterin * smiles: ** c1(=nc2(=c(nc1)n=c(n)nc(=o)2)) * inchi-key: ** pxzwkvixskscfr-uhfffaoysa-n...")
 
(9 intermediate revisions by 5 users not shown)
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ02816 ==
+
== Metabolite CPD0-1718 ==
−
* transcription-direction:
+
* common-name:
−
** positive
+
** 7,8-dihydropterin
−
* right-end-position:
+
* smiles:
−
** 908096
+
** c1(=nc2(=c(nc1)n=c(n)nc(=o)2))
−
* left-end-position:
+
* inchi-key:
−
** 902717
+
** pxzwkvixskscfr-uhfffaoysa-n
−
* centisome-position:
+
* molecular-weight:
−
** 83.21867   
+
** 165.154
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
* [[RXN-15261]]
−
== Reaction(s) associated ==
+
== Reaction(s) known to produce the compound ==
−
* [[OROPRIBTRANS-RXN]]
+
== Reaction(s) of unknown directionality ==
−
** Category: [[annotation]]
+
{{#set: common-name=7,8-dihydropterin}}
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: inchi-key=inchikey=pxzwkvixskscfr-uhfffaoysa-n}}
−
** Category: [[orthology]]
+
{{#set: molecular-weight=165.154}}
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
* [[OROTPDECARB-RXN]]
 
−
** Category: [[orthology]]
 
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
* [[ORPDC]]
 
−
** Category: [[orthology]]
 
−
*** source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
 
−
* [[ORPRT]]
 
−
** Category: [[orthology]]
 
−
*** source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
 
−
== Pathway(s) associated ==
 
−
* [[PWY-7791]]
 
−
** '''5''' reactions found over '''6''' reactions in the full pathway
 
−
* [[PWY-7790]]
 
−
** '''5''' reactions found over '''6''' reactions in the full pathway
 
−
* [[PWY-5686]]
 
−
** '''6''' reactions found over '''6''' reactions in the full pathway
 
−
{{#set: transcription-direction=positive}}
 
−
{{#set: right-end-position=908096}}
 
−
{{#set: left-end-position=902717}}
 
−
{{#set: centisome-position=83.21867    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=4}}
 
−
{{#set: nb pathway associated=3}}
 

Latest revision as of 11:13, 18 March 2021

Metabolite CPD0-1718

  • common-name:
    • 7,8-dihydropterin
  • smiles:
    • c1(=nc2(=c(nc1)n=c(n)nc(=o)2))
  • inchi-key:
    • pxzwkvixskscfr-uhfffaoysa-n
  • molecular-weight:
    • 165.154

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD0-1718&oldid=137939"