|
|
| (8 intermediate revisions by 4 users not shown) |
| Line 1: |
Line 1: |
| − | [[Category:reaction]] | + | [[Category:metabolite]] |
| − | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=GLYC3PDEHYDROGBIOSYN-RXN GLYC3PDEHYDROGBIOSYN-RXN] == | + | == Metabolite CPD0-1812 == |
| − | * direction:
| |
| − | ** left-to-right
| |
| | * common-name: | | * common-name: |
| − | ** glycerol-3-phosphate dehydrogenase | + | ** 2-oleoylglycerol |
| − | ** glycerol-3-phosphate dehydrogenase [nad+] | + | * smiles: |
| − | * ec-number:
| + | ** ccccccccc=ccccccccc(=o)oc(co)co |
| − | ** [http://enzyme.expasy.org/EC/1.1.1.94 ec-1.1.1.94] | + | * inchi-key: |
| − | == Reaction formula == | + | ** upwgqkdvauruge-ktkrtigzsa-n |
| − | * 1 [[DIHYDROXY-ACETONE-PHOSPHATE]][c] '''+''' 1 [[NADH-P-OR-NOP]][c] '''+''' 1 [[PROTON]][c] '''=>''' 1 [[GLYCEROL-3P]][c] '''+''' 1 [[NAD-P-OR-NOP]][c]
| + | * molecular-weight: |
| − | == Gene(s) associated with this reaction ==
| + | ** 356.545 |
| − | * Gene: [[SJ00878]] | + | == Reaction(s) known to consume the compound == |
| − | ** Category: [[annotation]]
| + | * [[RXN-15088]] |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a | + | * [[RXN-15090]] |
| − | ** Category: [[orthology]] | + | * [[RXN-15091]] |
| − | *** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
| + | == Reaction(s) known to produce the compound == |
| − | * Gene: [[SJ16475]]
| + | == Reaction(s) of unknown directionality == |
| − | ** Category: [[annotation]]
| + | {{#set: common-name=2-oleoylglycerol}} |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
| + | {{#set: inchi-key=inchikey=upwgqkdvauruge-ktkrtigzsa-n}} |
| − | ** Category: [[orthology]]
| + | {{#set: molecular-weight=356.545}} |
| − | *** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a | |
| − | == Pathway(s) == | |
| − | * [[PWY-7902]], glucosylglycerol biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7902 PWY-7902] | |
| − | ** '''2''' reactions found over '''5''' reactions in the full pathway
| |
| − | * [[PWY-5981]], CDP-diacylglycerol biosynthesis III: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5981 PWY-5981] | |
| − | ** '''3''' reactions found over '''5''' reactions in the full pathway
| |
| − | * [[PWY0-1319]], CDP-diacylglycerol biosynthesis II: [http://metacyc.org/META/NEW-IMAGE?object=PWY0-1319 PWY0-1319]
| |
| − | ** '''4''' reactions found over '''4''' reactions in the full pathway
| |
| − | * [[PWY-5667]], CDP-diacylglycerol biosynthesis I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5667 PWY-5667] | |
| − | ** '''4''' reactions found over '''4''' reactions in the full pathway
| |
| − | == Reconstruction information == | |
| − | * category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | * category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
| |
| − | == External links == | |
| − | * RHEA:
| |
| − | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=11094 11094]
| |
| − | * LIGAND-RXN:
| |
| − | ** [http://www.genome.jp/dbget-bin/www_bget?R00844 R00844]
| |
| − | ** [http://www.genome.jp/dbget-bin/www_bget?R05680 R05680]
| |
| − | {{#set: direction=left-to-right}}
| |
| − | {{#set: common-name=glycerol-3-phosphate dehydrogenase|glycerol-3-phosphate dehydrogenase [nad+]}} | |
| − | {{#set: ec-number=ec-1.1.1.94}} | |
| − | {{#set: nb gene associated=2}} | |
| − | {{#set: nb pathway associated=4}}
| |
| − | {{#set: reconstruction category=orthology|annotation}}
| |
| − | {{#set: reconstruction tool=pantograph|pathwaytools}}
| |
| − | {{#set: reconstruction comment=n.a}}
| |
| − | {{#set: reconstruction source=saccharina_japonica_genome|output_pantograph_ectocarpus_siliculosus}}
| |
