Difference between revisions of "CPD0-1905"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CYS == * common-name: ** l-cysteine * smiles: ** c(s)c(c(=o)[o-])[n+] * inchi-key: ** xujnekjlayxesh-reohclbhsa-n * molecular-weight: **...")
(Created page with "Category:metabolite == Metabolite ALPHA-GLC-6-P == * common-name: ** α-d-glucose 6-phosphate * smiles: ** c(op(=o)([o-])[o-])c1(oc(o)c(o)c(o)c(o)1) * inchi-key: ** n...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CYS ==
+
== Metabolite ALPHA-GLC-6-P ==
 
* common-name:
 
* common-name:
** l-cysteine
+
** α-d-glucose 6-phosphate
 
* smiles:
 
* smiles:
** c(s)c(c(=o)[o-])[n+]
+
** c(op(=o)([o-])[o-])c1(oc(o)c(o)c(o)c(o)1)
 
* inchi-key:
 
* inchi-key:
** xujnekjlayxesh-reohclbhsa-n
+
** nbschqhzlsjfnq-dvkngefbsa-l
 
* molecular-weight:
 
* molecular-weight:
** 121.154
+
** 258.121
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[ACSERLY-RXN]]
+
* [[G6PADH]]
* [[CYSPH-RXN]]
+
* [[G6PADHh]]
* [[CYSTATHIONASE-RXN]]
+
* [[G6PI]]
* [[CYSTEINE--TRNA-LIGASE-RXN]]
+
* [[GLUCOSE-6-PHOSPHATE-1-EPIMERASE-RXN]]
* [[CYSTEINE-AMINOTRANSFERASE-RXN]]
+
* [[PGCM]]
* [[CYSTEINE-DIOXYGENASE-RXN]]
+
* [[PGIA]]
* [[GLUTCYSLIG-RXN]]
+
* [[PGIAh]]
* [[LCYSDESULF-RXN]]
+
* [[PGMTh]]
* [[O-SUCCHOMOSERLYASE-RXN]]
+
* [[RXN-15312]]
* [[P-PANTOCYSLIG-RXN]]
+
* [[UG6PGT]]
* [[RXN-12588]]
+
* [[UG6PGTn]]
* [[RXN-14385]]
 
* [[RXN-15129]]
 
* [[RXN-15881]]
 
* [[RXN-8351]]
 
* [[RXN-9787]]
 
* [[RXN0-308]]
 
* [[RXN1G-121]]
 
* [[biomass_rxn]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[1.8.3.5-RXN]]
+
* [[G6PI]]
* [[ACSERLY-RXN]]
+
* [[GLUCOSE-6-PHOSPHATE-1-EPIMERASE-RXN]]
* [[CYSTATHIONASE-RXN]]
+
* [[PGCM]]
* [[CYSTEINE-AMINOTRANSFERASE-RXN]]
+
* [[PGIA]]
* [[O-SUCCHOMOSERLYASE-RXN]]
+
* [[PGIAh]]
* [[RXN-11623]]
+
* [[PGMTh]]
* [[RXN-14048]]
 
* [[RXN-15130]]
 
* [[RXN-16637]]
 
* [[RXN-6622]]
 
* [[RXN-9787]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=l-cysteine}}
+
{{#set: common-name=α-d-glucose 6-phosphate}}
{{#set: inchi-key=inchikey=xujnekjlayxesh-reohclbhsa-n}}
+
{{#set: inchi-key=inchikey=nbschqhzlsjfnq-dvkngefbsa-l}}
{{#set: molecular-weight=121.154}}
+
{{#set: molecular-weight=258.121}}

Revision as of 11:19, 15 January 2021

Metabolite ALPHA-GLC-6-P

  • common-name:
    • α-d-glucose 6-phosphate
  • smiles:
    • c(op(=o)([o-])[o-])c1(oc(o)c(o)c(o)c(o)1)
  • inchi-key:
    • nbschqhzlsjfnq-dvkngefbsa-l
  • molecular-weight:
    • 258.121

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality