Difference between revisions of "CPD0-1905"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite ALPHA-GLC-6-P == * common-name: ** α-d-glucose 6-phosphate * smiles: ** c(op(=o)([o-])[o-])c1(oc(o)c(o)c(o)c(o)1) * inchi-key: ** n...") |
(Created page with "Category:metabolite == Metabolite CHONDROITIN-4-SULFATE == * common-name: ** [chondroitin]-4-o-sulfo-n-acetylgalactosamine == Reaction(s) known to consume the compound ==...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CHONDROITIN-4-SULFATE == |
* common-name: | * common-name: | ||
| − | ** | + | ** [chondroitin]-4-o-sulfo-n-acetylgalactosamine |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[3.1.6.12-RXN]] |
| − | + | * [[RXN-7954]] | |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | * [[RXN- | ||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[CHONDROITIN-4-SULFOTRANSFERASE-RXN]] |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=[chondroitin]-4-o-sulfo-n-acetylgalactosamine}} |
| − | |||
| − | |||
Revision as of 08:31, 15 March 2021
Contents
Metabolite CHONDROITIN-4-SULFATE
- common-name:
- [chondroitin]-4-o-sulfo-n-acetylgalactosamine
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "chondroitin]-4-o-sulfo-n-acetylgalactosamine" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.
