Difference between revisions of "CPD0-2030"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 2-ACYL-GPE == * common-name: ** a 2-acyl-1-lyso-phosphatidylethanolamine == Reaction(s) known to consume the compound == == Reaction(s) k...")
(Created page with "Category:metabolite == Metabolite CPD0-2030 == * common-name: ** glycerophosphoserine * smiles: ** c(o)c(o)cop([o-])(occ([n+])c(=o)[o-])=o * inchi-key: ** zwzwygmenqvnfu-u...")
 
(6 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 2-ACYL-GPE ==
+
== Metabolite CPD0-2030 ==
 
* common-name:
 
* common-name:
** a 2-acyl-1-lyso-phosphatidylethanolamine
+
** glycerophosphoserine
 +
* smiles:
 +
** c(o)c(o)cop([o-])(occ([n+])c(=o)[o-])=o
 +
* inchi-key:
 +
** zwzwygmenqvnfu-uhnvwzdzsa-m
 +
* molecular-weight:
 +
** 258.144
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-14136]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN0-6952]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a 2-acyl-1-lyso-phosphatidylethanolamine}}
+
{{#set: common-name=glycerophosphoserine}}
 +
{{#set: inchi-key=inchikey=zwzwygmenqvnfu-uhnvwzdzsa-m}}
 +
{{#set: molecular-weight=258.144}}

Latest revision as of 11:13, 18 March 2021

Metabolite CPD0-2030

  • common-name:
    • glycerophosphoserine
  • smiles:
    • c(o)c(o)cop([o-])(occ([n+])c(=o)[o-])=o
  • inchi-key:
    • zwzwygmenqvnfu-uhnvwzdzsa-m
  • molecular-weight:
    • 258.144

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality