Difference between revisions of "CPD0-2030"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ11321 == * transcription-direction: ** positive * right-end-position: ** 314267 * left-end-position: ** 309283 * centisome-position: ** 82.80026...")
 
(Created page with "Category:metabolite == Metabolite CPD0-2030 == * common-name: ** glycerophosphoserine * smiles: ** c(o)c(o)cop([o-])(occ([n+])c(=o)[o-])=o * inchi-key: ** zwzwygmenqvnfu-u...")
 
(9 intermediate revisions by 5 users not shown)
Line 1: Line 1:
[[Category:gene]]
+
[[Category:metabolite]]
== Gene SJ11321 ==
+
== Metabolite CPD0-2030 ==
* transcription-direction:
+
* common-name:
** positive
+
** glycerophosphoserine
* right-end-position:
+
* smiles:
** 314267
+
** c(o)c(o)cop([o-])(occ([n+])c(=o)[o-])=o
* left-end-position:
+
* inchi-key:
** 309283
+
** zwzwygmenqvnfu-uhnvwzdzsa-m
* centisome-position:
+
* molecular-weight:
** 82.80026   
+
** 258.144
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
* [[S.japonica_carotenoid_curated]]
+
* [[RXN-14136]]
== Reaction(s) associated ==
+
== Reaction(s) known to produce the compound ==
* [[HISTONE-LYSINE-N-METHYLTRANSFERASE-RXN]]
+
== Reaction(s) of unknown directionality ==
** Category: [[annotation]]
+
{{#set: common-name=glycerophosphoserine}}
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: inchi-key=inchikey=zwzwygmenqvnfu-uhnvwzdzsa-m}}
{{#set: transcription-direction=positive}}
+
{{#set: molecular-weight=258.144}}
{{#set: right-end-position=314267}}
 
{{#set: left-end-position=309283}}
 
{{#set: centisome-position=82.80026    }}
 
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
{{#set: nb reaction associated=1}}
 

Latest revision as of 11:13, 18 March 2021

Metabolite CPD0-2030

  • common-name:
    • glycerophosphoserine
  • smiles:
    • c(o)c(o)cop([o-])(occ([n+])c(=o)[o-])=o
  • inchi-key:
    • zwzwygmenqvnfu-uhnvwzdzsa-m
  • molecular-weight:
    • 258.144

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality