Difference between revisions of "CPD0-2030"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD0-2340 == * common-name: ** (z)-3-peroxyaminoacrylate * smiles: ** [ch](n)=cc(=o)oo * inchi-key: ** wqkgfglgyohjog-uphrsurjsa-n * mole...")
(Created page with "Category:metabolite == Metabolite CPD-11525 == * common-name: ** 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-butanoyl-coa * smiles: ** ccc=ccc1(c(ccc(=o)1)cccc(=o)sccnc(=o)cc...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD0-2340 ==
+
== Metabolite CPD-11525 ==
 
* common-name:
 
* common-name:
** (z)-3-peroxyaminoacrylate
+
** 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-butanoyl-coa
 
* smiles:
 
* smiles:
** [ch](n)=cc(=o)oo
+
** ccc=ccc1(c(ccc(=o)1)cccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-])
 
* inchi-key:
 
* inchi-key:
** wqkgfglgyohjog-uphrsurjsa-n
+
** yyuzysvpfvoylb-rguwmiccsa-j
 
* molecular-weight:
 
* molecular-weight:
** 103.077
+
** 983.813
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-10707]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-12894]]
+
* [[RXN-10700]]
* [[RXN0-6460]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(z)-3-peroxyaminoacrylate}}
+
{{#set: common-name=3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-butanoyl-coa}}
{{#set: inchi-key=inchikey=wqkgfglgyohjog-uphrsurjsa-n}}
+
{{#set: inchi-key=inchikey=yyuzysvpfvoylb-rguwmiccsa-j}}
{{#set: molecular-weight=103.077}}
+
{{#set: molecular-weight=983.813}}

Revision as of 18:55, 14 January 2021

Metabolite CPD-11525

  • common-name:
    • 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-butanoyl-coa
  • smiles:
    • ccc=ccc1(c(ccc(=o)1)cccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-])
  • inchi-key:
    • yyuzysvpfvoylb-rguwmiccsa-j
  • molecular-weight:
    • 983.813

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality