Difference between revisions of "CPD0-2105"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite TREHALOSE-6P == * common-name: ** α,α-trehalose 6-phosphate * smiles: ** c(c1(oc(c(c(c1o)o)o)oc2(c(c(c(c(o2)cop([o-])(=o)[o-]...")
(Created page with "Category:metabolite == Metabolite NIACINAMIDE == * common-name: ** nicotinamide * smiles: ** c1(n=cc(c(=o)n)=cc=1) * inchi-key: ** dfpaksucgfbddf-uhfffaoysa-n * molecular-...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite TREHALOSE-6P ==
+
== Metabolite NIACINAMIDE ==
 
* common-name:
 
* common-name:
** α,α-trehalose 6-phosphate
+
** nicotinamide
 
* smiles:
 
* smiles:
** c(c1(oc(c(c(c1o)o)o)oc2(c(c(c(c(o2)cop([o-])(=o)[o-])o)o)o)))o
+
** c1(n=cc(c(=o)n)=cc=1)
 
* inchi-key:
 
* inchi-key:
** labspybhmpdtel-lizsdcnhsa-l
+
** dfpaksucgfbddf-uhfffaoysa-n
 
* molecular-weight:
 
* molecular-weight:
** 420.263
+
** 122.126
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[TREHALOSEPHOSPHA-RXN]]
+
* [[2.4.2.31-RXN]]
 +
* [[NAD+-ADP-RIBOSYLTRANSFERASE-RXN]]
 +
* [[NICOTINAMIDE-N-METHYLTRANSFERASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[TREHALOSE6PSYN-RXN]]
+
* [[2.4.2.31-RXN]]
* [[UG6PGT]]
+
* [[2.7.1.160-RXN]]
* [[UG6PGTn]]
+
* [[NAD+-ADP-RIBOSYLTRANSFERASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=α,α-trehalose 6-phosphate}}
+
{{#set: common-name=nicotinamide}}
{{#set: inchi-key=inchikey=labspybhmpdtel-lizsdcnhsa-l}}
+
{{#set: inchi-key=inchikey=dfpaksucgfbddf-uhfffaoysa-n}}
{{#set: molecular-weight=420.263}}
+
{{#set: molecular-weight=122.126}}

Revision as of 08:28, 15 March 2021

Metabolite NIACINAMIDE

  • common-name:
    • nicotinamide
  • smiles:
    • c1(n=cc(c(=o)n)=cc=1)
  • inchi-key:
    • dfpaksucgfbddf-uhfffaoysa-n
  • molecular-weight:
    • 122.126

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality