Difference between revisions of "CPD0-2105"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite NIACINAMIDE == * common-name: ** nicotinamide * smiles: ** c1(n=cc(c(=o)n)=cc=1) * inchi-key: ** dfpaksucgfbddf-uhfffaoysa-n * molecular-...")
(Created page with "Category:metabolite == Metabolite CPD0-2105 == * common-name: ** 3-oxododecanoyl-coa * smiles: ** cccccccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op(...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite NIACINAMIDE ==
+
== Metabolite CPD0-2105 ==
 
* common-name:
 
* common-name:
** nicotinamide
+
** 3-oxododecanoyl-coa
 
* smiles:
 
* smiles:
** c1(n=cc(c(=o)n)=cc=1)
+
** cccccccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
* inchi-key:
** dfpaksucgfbddf-uhfffaoysa-n
+
** hqanbzhvwidnqz-gmhmeamdsa-j
 
* molecular-weight:
 
* molecular-weight:
** 122.126
+
** 959.791
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[2.4.2.31-RXN]]
+
* [[HACD5]]
* [[NAD+-ADP-RIBOSYLTRANSFERASE-RXN]]
+
* [[HACD5h]]
* [[NICOTINAMIDE-N-METHYLTRANSFERASE-RXN]]
+
* [[HACD5m]]
 +
* [[RXN-14274]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[2.4.2.31-RXN]]
+
* [[HACD5]]
* [[2.7.1.160-RXN]]
+
* [[HACD5h]]
* [[NAD+-ADP-RIBOSYLTRANSFERASE-RXN]]
+
* [[HACD5m]]
 +
* [[RXN-14274]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=nicotinamide}}
+
{{#set: common-name=3-oxododecanoyl-coa}}
{{#set: inchi-key=inchikey=dfpaksucgfbddf-uhfffaoysa-n}}
+
{{#set: inchi-key=inchikey=hqanbzhvwidnqz-gmhmeamdsa-j}}
{{#set: molecular-weight=122.126}}
+
{{#set: molecular-weight=959.791}}

Latest revision as of 11:15, 18 March 2021

Metabolite CPD0-2105

  • common-name:
    • 3-oxododecanoyl-coa
  • smiles:
    • cccccccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • hqanbzhvwidnqz-gmhmeamdsa-j
  • molecular-weight:
    • 959.791

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality