Difference between revisions of "CPD0-2105"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 4-AMINO-BUTYRALDEHYDE == * common-name: ** 4-aminobutanal * smiles: ** c(c[n+])cc=o * inchi-key: ** dzqlqeyleywjib-uhfffaoysa-o * molecul...") |
(Created page with "Category:metabolite == Metabolite L-GULONATE == * common-name: ** l-gulonate * smiles: ** c(o)c(o)c(o)c(o)c(o)c(=o)[o-] * inchi-key: ** rghnjxzeokukbd-qtbdoelssa-m * molec...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite L-GULONATE == |
* common-name: | * common-name: | ||
− | ** | + | ** l-gulonate |
* smiles: | * smiles: | ||
− | ** c(c | + | ** c(o)c(o)c(o)c(o)c(o)c(=o)[o-] |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** rghnjxzeokukbd-qtbdoelssa-m |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 195.149 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[GLUCURONATE-REDUCTASE-RXN]] |
+ | * [[RXN-8783]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=l-gulonate}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=rghnjxzeokukbd-qtbdoelssa-m}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=195.149}} |
Revision as of 15:28, 5 January 2021
Contents
Metabolite L-GULONATE
- common-name:
- l-gulonate
- smiles:
- c(o)c(o)c(o)c(o)c(o)c(=o)[o-]
- inchi-key:
- rghnjxzeokukbd-qtbdoelssa-m
- molecular-weight:
- 195.149