Difference between revisions of "CPD0-2105"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite L-GULONATE == * common-name: ** l-gulonate * smiles: ** c(o)c(o)c(o)c(o)c(o)c(=o)[o-] * inchi-key: ** rghnjxzeokukbd-qtbdoelssa-m * molec...") |
(Created page with "Category:metabolite == Metabolite DOPAMINE == * common-name: ** dopamine * smiles: ** c(cc1(c=c(c(=cc=1)o)o))[n+] * inchi-key: ** vyfyytllbukuhu-uhfffaoysa-o * molecular-w...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite DOPAMINE == |
* common-name: | * common-name: | ||
| − | ** | + | ** dopamine |
* smiles: | * smiles: | ||
| − | ** c( | + | ** c(cc1(c=c(c(=cc=1)o)o))[n+] |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** vyfyytllbukuhu-uhfffaoysa-o |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 154.188 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[DOPAMINE-BETA-MONOOXYGENASE-RXN]] | ||
| + | * [[RXN6666-4]] | ||
| + | * [[RXN6666-9]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN66-221]] |
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=dopamine}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=vyfyytllbukuhu-uhfffaoysa-o}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=154.188}} |
Revision as of 13:11, 14 January 2021
Contents
Metabolite DOPAMINE
- common-name:
- dopamine
- smiles:
- c(cc1(c=c(c(=cc=1)o)o))[n+]
- inchi-key:
- vyfyytllbukuhu-uhfffaoysa-o
- molecular-weight:
- 154.188
