Difference between revisions of "CPD0-2106"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=2.7.1.133-RXN 2.7.1.133-RXN] == * direction: ** left-to-right * common-name: ** inositol 1,3,4-trip...")
 
(Created page with "Category:metabolite == Metabolite CPD0-2106 == * common-name: ** 3-oxooctanoyl-coa * smiles: ** cccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(...")
 
(9 intermediate revisions by 5 users not shown)
Line 1: Line 1:
[[Category:reaction]]
+
[[Category:metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=2.7.1.133-RXN 2.7.1.133-RXN] ==
+
== Metabolite CPD0-2106 ==
* direction:
 
** left-to-right
 
 
* common-name:
 
* common-name:
** inositol 1,3,4-triphosphate 6 kinase
+
** 3-oxooctanoyl-coa
* ec-number:
+
* smiles:
** [http://enzyme.expasy.org/EC/2.7.1.159 ec-2.7.1.159]
+
** cccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
== Reaction formula ==
+
* inchi-key:
* 1 [[ATP]][c] '''+''' 1 [[INOSITOL-1-3-4-TRIPHOSPHATE]][c] '''=>''' 1 [[ADP]][c] '''+''' 1 [[CPD-505]][c] '''+''' 1 [[PROTON]][c]
+
** wpivbcgrgvnddt-cecatxlmsa-j
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
* Gene: [[SJ15244]]
+
** 903.684
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[RXN-13279-CPD-14916/NADP//CPD0-2106/NADPH/PROTON.39.]]
** Category: [[orthology]]
+
* [[RXN-14277]]
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
== Reaction(s) known to produce the compound ==
== Pathway(s) ==
+
* [[RXN-13279-CPD-14916/NADP//CPD0-2106/NADPH/PROTON.39.]]
* [[PWY-6362]], 1D-myo-inositol hexakisphosphate biosynthesis II (mammalian): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6362 PWY-6362]
+
* [[RXN-14275]]
** '''5''' reactions found over '''5''' reactions in the full pathway
+
* [[RXN-14277]]
* [[PWY-6554]], 1D-myo-inositol hexakisphosphate biosynthesis V (from Ins(1,3,4)P3): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6554 PWY-6554]
+
== Reaction(s) of unknown directionality ==
** '''5''' reactions found over '''5''' reactions in the full pathway
+
{{#set: common-name=3-oxooctanoyl-coa}}
* [[PWY-6365]], D-myo-inositol (3,4,5,6)-tetrakisphosphate biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6365 PWY-6365]
+
{{#set: inchi-key=inchikey=wpivbcgrgvnddt-cecatxlmsa-j}}
** '''3''' reactions found over '''4''' reactions in the full pathway
+
{{#set: molecular-weight=903.684}}
* [[PWY-6366]], D-myo-inositol (1,4,5,6)-tetrakisphosphate biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6366 PWY-6366]
 
** '''3''' reactions found over '''4''' reactions in the full pathway
 
== Reconstruction information  ==
 
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
* category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
== External links  ==
 
* RHEA:
 
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=20941 20941]
 
* LIGAND-RXN:
 
** [http://www.genome.jp/dbget-bin/www_bget?R03429 R03429]
 
{{#set: direction=left-to-right}}
 
{{#set: common-name=inositol 1,3,4-triphosphate 6 kinase}}
 
{{#set: ec-number=ec-2.7.1.159}}
 
{{#set: nb gene associated=1}}
 
{{#set: nb pathway associated=4}}
 
{{#set: reconstruction category=orthology|annotation}}
 
{{#set: reconstruction tool=pathwaytools|pantograph}}
 
{{#set: reconstruction comment=n.a}}
 
{{#set: reconstruction source=output_pantograph_ectocarpus_siliculosus|saccharina_japonica_genome}}
 

Latest revision as of 11:17, 18 March 2021

Metabolite CPD0-2106

  • common-name:
    • 3-oxooctanoyl-coa
  • smiles:
    • cccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • wpivbcgrgvnddt-cecatxlmsa-j
  • molecular-weight:
    • 903.684

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality