Difference between revisions of "CPD0-2106"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite BCAA-dehydrogenase-DH-lipoyl == * common-name: ** an [apo bcaa dehydrogenase e2 protein] n6-dihydrolipoyl-l-lysine == Reaction(s) known t...") |
(Created page with "Category:metabolite == Metabolite CPD0-2106 == * common-name: ** 3-oxooctanoyl-coa * smiles: ** cccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD0-2106 == |
* common-name: | * common-name: | ||
− | ** | + | ** 3-oxooctanoyl-coa |
+ | * smiles: | ||
+ | ** cccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-] | ||
+ | * inchi-key: | ||
+ | ** wpivbcgrgvnddt-cecatxlmsa-j | ||
+ | * molecular-weight: | ||
+ | ** 903.684 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN-13279-CPD-14916/NADP//CPD0-2106/NADPH/PROTON.39.]] |
− | + | * [[RXN-14277]] | |
− | |||
− | * [[RXN- | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN-13279-CPD-14916/NADP//CPD0-2106/NADPH/PROTON.39.]] |
− | * [[ | + | * [[RXN-14275]] |
− | * [[RXN- | + | * [[RXN-14277]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=3-oxooctanoyl-coa}} |
+ | {{#set: inchi-key=inchikey=wpivbcgrgvnddt-cecatxlmsa-j}} | ||
+ | {{#set: molecular-weight=903.684}} |
Latest revision as of 11:17, 18 March 2021
Contents
Metabolite CPD0-2106
- common-name:
- 3-oxooctanoyl-coa
- smiles:
- cccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
- inchi-key:
- wpivbcgrgvnddt-cecatxlmsa-j
- molecular-weight:
- 903.684