Difference between revisions of "CPD0-2107"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ00909 == * transcription-direction: ** negative * right-end-position: ** 97095 * left-end-position: ** 83113 * centisome-position: ** 51.902805...")
(Created page with "Category:metabolite == Metabolite CPD-7100 == * common-name: ** (2s)-2-isopropyl-3-oxosuccinate * smiles: ** cc(c(c(=o)[o-])c(=o)c(=o)[o-])c * inchi-key: ** hiizagqwabamrr...")
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ00909 ==
+
== Metabolite CPD-7100 ==
−
* transcription-direction:
+
* common-name:
−
** negative
+
** (2s)-2-isopropyl-3-oxosuccinate
−
* right-end-position:
+
* smiles:
−
** 97095
+
** cc(c(c(=o)[o-])c(=o)c(=o)[o-])c
−
* left-end-position:
+
* inchi-key:
−
** 83113
+
** hiizagqwabamrr-bypyzucnsa-l
−
* centisome-position:
+
* molecular-weight:
−
** 51.902805   
+
** 172.137
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
* [[3-ISOPROPYLMALDEHYDROG-RXN]]
−
== Reaction(s) associated ==
+
== Reaction(s) known to produce the compound ==
−
* [[FERREDOXIN--NITRITE-REDUCTASE-RXN]]
+
* [[3-ISOPROPYLMALDEHYDROG-RXN]]
−
** Category: [[annotation]]
+
* [[IMDH]]
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
== Reaction(s) of unknown directionality ==
−
** Category: [[orthology]]
+
{{#set: common-name=(2s)-2-isopropyl-3-oxosuccinate}}
−
*** source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
+
{{#set: inchi-key=inchikey=hiizagqwabamrr-bypyzucnsa-l}}
−
*** source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a
+
{{#set: molecular-weight=172.137}}
−
*** source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a
 
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
== Pathway(s) associated ==
 
−
* [[PWY490-3]]
 
−
** '''3''' reactions found over '''4''' reactions in the full pathway
 
−
* [[PWY-381]]
 
−
** '''3''' reactions found over '''3''' reactions in the full pathway
 
−
{{#set: transcription-direction=negative}}
 
−
{{#set: right-end-position=97095}}
 
−
{{#set: left-end-position=83113}}
 
−
{{#set: centisome-position=51.902805    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=1}}
 
−
{{#set: nb pathway associated=2}}
 

Revision as of 20:30, 18 December 2020

Metabolite CPD-7100

  • common-name:
    • (2s)-2-isopropyl-3-oxosuccinate
  • smiles:
    • cc(c(c(=o)[o-])c(=o)c(=o)[o-])c
  • inchi-key:
    • hiizagqwabamrr-bypyzucnsa-l
  • molecular-weight:
    • 172.137

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD0-2107&oldid=45781"