Difference between revisions of "CPD0-2108"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite DNA-6-O-Methyl-Guanines == * common-name: ** an o6-methylguanine in dna == Reaction(s) known to consume the compound == * [[2.1.1.63-RXN]...") |
(Created page with "Category:metabolite == Metabolite CPD0-2108 == * common-name: ** (2e)-oct-2-enoyl-coa * smiles: ** cccccc=cc(=o)sccnc(=o)ccnc(c(o)c(c)(c)cop([o-])(=o)op([o-])(=o)occ1(c(op...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD0-2108 == |
* common-name: | * common-name: | ||
| − | ** | + | ** (2e)-oct-2-enoyl-coa |
| + | * smiles: | ||
| + | ** cccccc=cc(=o)sccnc(=o)ccnc(c(o)c(c)(c)cop([o-])(=o)op([o-])(=o)occ1(c(op(=o)([o-])[o-])c(o)c(o1)n3(c=nc2(c(n)=nc=nc=23))))=o | ||
| + | * inchi-key: | ||
| + | ** cpsdnaxxkwvyiy-ntlmcjqisa-j | ||
| + | * molecular-weight: | ||
| + | ** 887.685 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-14229]] |
| + | * [[RXN-14276]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[ACOA80OR]] | ||
| + | * [[RXN-12669]] | ||
| + | * [[RXN-14229]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=(2e)-oct-2-enoyl-coa}} |
| + | {{#set: inchi-key=inchikey=cpsdnaxxkwvyiy-ntlmcjqisa-j}} | ||
| + | {{#set: molecular-weight=887.685}} | ||
Latest revision as of 11:12, 18 March 2021
Contents
Metabolite CPD0-2108
- common-name:
- (2e)-oct-2-enoyl-coa
- smiles:
- cccccc=cc(=o)sccnc(=o)ccnc(c(o)c(c)(c)cop([o-])(=o)op([o-])(=o)occ1(c(op(=o)([o-])[o-])c(o)c(o1)n3(c=nc2(c(n)=nc=nc=23))))=o
- inchi-key:
- cpsdnaxxkwvyiy-ntlmcjqisa-j
- molecular-weight:
- 887.685
