Difference between revisions of "CPD0-2113"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-17894 == * common-name: ** β-d-mannosyl-(c55 ω-saturated dolichyl phosphate) * smiles: ** cc(c)cccc(c)=cccc(c)=cccc(c)=ccc...")
(Created page with "Category:metabolite == Metabolite CPD0-2113 == * common-name: ** 1-stearoyl-sn-glycerol 3-phosphate * smiles: ** cccccccccccccccccc(=o)occ(o)cop(=o)([o-])[o-] * inchi-key:...")
 
(6 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-17894 ==
+
== Metabolite CPD0-2113 ==
 
* common-name:
 
* common-name:
** β-d-mannosyl-(c55 ω-saturated dolichyl phosphate)
+
** 1-stearoyl-sn-glycerol 3-phosphate
 
* smiles:
 
* smiles:
** cc(c)cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(ccop(=o)([o-])oc1(oc(co)c(o)c(o)c(o)1))c
+
** cccccccccccccccccc(=o)occ(o)cop(=o)([o-])[o-]
 
* inchi-key:
 
* inchi-key:
** mbyvktiiznuhkn-nivaaieqsa-m
+
** layxstyjrsvxih-hxuwfjfhsa-l
 
* molecular-weight:
 
* molecular-weight:
** 1012.461
+
** 436.524
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-16025]]
 +
* [[RXN-16067]]
 +
* [[RXN-16076]]
 +
* [[RXN-16077]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-16602]]
+
* [[RXN-16024]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=β-d-mannosyl-(c55 ω-saturated dolichyl phosphate)}}
+
{{#set: common-name=1-stearoyl-sn-glycerol 3-phosphate}}
{{#set: inchi-key=inchikey=mbyvktiiznuhkn-nivaaieqsa-m}}
+
{{#set: inchi-key=inchikey=layxstyjrsvxih-hxuwfjfhsa-l}}
{{#set: molecular-weight=1012.461}}
+
{{#set: molecular-weight=436.524}}

Latest revision as of 11:15, 18 March 2021

Metabolite CPD0-2113

  • common-name:
    • 1-stearoyl-sn-glycerol 3-phosphate
  • smiles:
    • cccccccccccccccccc(=o)occ(o)cop(=o)([o-])[o-]
  • inchi-key:
    • layxstyjrsvxih-hxuwfjfhsa-l
  • molecular-weight:
    • 436.524

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality