Difference between revisions of "CPD0-2117"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite NNN-trimethyl-terminal-XPK == * common-name: ** an n terminal n,n,n-trimethyl-(a/s)pk-[protein] == Reaction(s) known to consume the compo...")
(Created page with "Category:metabolite == Metabolite CPD0-1308 == * common-name: ** glyphosate * smiles: ** c(ncc(=o)[o-])p(o)([o-])=o * inchi-key: ** xddaorkbjwwyjs-uhfffaoysa-l * molecular...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite NNN-trimethyl-terminal-XPK ==
+
== Metabolite CPD0-1308 ==
 
* common-name:
 
* common-name:
** an n terminal n,n,n-trimethyl-(a/s)pk-[protein]
+
** glyphosate
 +
* smiles:
 +
** c(ncc(=o)[o-])p(o)([o-])=o
 +
* inchi-key:
 +
** xddaorkbjwwyjs-uhfffaoysa-l
 +
* molecular-weight:
 +
** 167.058
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-17951]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-13224]]
 
* [[RXN-13225]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=an n terminal n,n,n-trimethyl-(a/s)pk-[protein]}}
+
{{#set: common-name=glyphosate}}
 +
{{#set: inchi-key=inchikey=xddaorkbjwwyjs-uhfffaoysa-l}}
 +
{{#set: molecular-weight=167.058}}

Revision as of 18:58, 14 January 2021

Metabolite CPD0-1308

  • common-name:
    • glyphosate
  • smiles:
    • c(ncc(=o)[o-])p(o)([o-])=o
  • inchi-key:
    • xddaorkbjwwyjs-uhfffaoysa-l
  • molecular-weight:
    • 167.058

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality