Difference between revisions of "CPD0-2121"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ22385 == * transcription-direction: ** negative * right-end-position: ** 33452 * left-end-position: ** 30378 * centisome-position: ** 17.128069...") |
(Created page with "Category:metabolite == Metabolite CPD0-2121 == * common-name: ** trans-hex-2-enoyl-coa * smiles: ** cccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=...") |
||
| (7 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite CPD0-2121 == |
| − | * | + | * common-name: |
| − | ** | + | ** trans-hex-2-enoyl-coa |
| − | + | * smiles: | |
| − | + | ** cccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-] | |
| − | + | * inchi-key: | |
| − | + | ** oinxhibnzuuimr-ixuyqxaasa-j | |
| − | * | + | * molecular-weight: |
| − | ** | + | ** 859.631 |
| − | == | + | == Reaction(s) known to consume the compound == |
| − | + | * [[ECOAH2h]] | |
| − | = | + | * [[RXN-12559]] |
| − | + | * [[RXN-14278]] | |
| − | * | + | * [[TRANSENOYLCOARED-RXN-HEXANOYL-COA/NADP//CPD0-2121/NADPH/PROTON.42.]] |
| − | *** | + | == Reaction(s) known to produce the compound == |
| − | * | + | * [[ECOAH2h]] |
| − | * | + | * [[RXN-12567]] |
| − | * [[ | + | * [[RXN-14278]] |
| − | * | + | == Reaction(s) of unknown directionality == |
| − | * | + | {{#set: common-name=trans-hex-2-enoyl-coa}} |
| − | {{#set: | + | {{#set: inchi-key=inchikey=oinxhibnzuuimr-ixuyqxaasa-j}} |
| − | + | {{#set: molecular-weight=859.631}} | |
| − | |||
| − | {{#set: | ||
| − | {{#set: | ||
| − | |||
Latest revision as of 11:13, 18 March 2021
Contents
Metabolite CPD0-2121
- common-name:
- trans-hex-2-enoyl-coa
- smiles:
- cccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
- inchi-key:
- oinxhibnzuuimr-ixuyqxaasa-j
- molecular-weight:
- 859.631
