Difference between revisions of "CPD0-2121"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite D-ERYTHRULOSE == * common-name: ** d-erythrulose * smiles: ** c(o)c(o)c(=o)co * inchi-key: ** uqphvqvxlprncx-gsvougtgsa-n * molecular-wei...") |
(Created page with "Category:metabolite == Metabolite CPD0-2121 == * common-name: ** trans-hex-2-enoyl-coa * smiles: ** cccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=...") |
||
(5 intermediate revisions by 3 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD0-2121 == |
* common-name: | * common-name: | ||
− | ** | + | ** trans-hex-2-enoyl-coa |
* smiles: | * smiles: | ||
− | ** c(o)c(o)c(=o) | + | ** cccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-] |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** oinxhibnzuuimr-ixuyqxaasa-j |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 859.631 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[ECOAH2h]] |
− | * [[RXN- | + | * [[RXN-12559]] |
+ | * [[RXN-14278]] | ||
+ | * [[TRANSENOYLCOARED-RXN-HEXANOYL-COA/NADP//CPD0-2121/NADPH/PROTON.42.]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[ECOAH2h]] |
− | * [[RXN- | + | * [[RXN-12567]] |
+ | * [[RXN-14278]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=trans-hex-2-enoyl-coa}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=oinxhibnzuuimr-ixuyqxaasa-j}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=859.631}} |
Latest revision as of 11:13, 18 March 2021
Contents
Metabolite CPD0-2121
- common-name:
- trans-hex-2-enoyl-coa
- smiles:
- cccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
- inchi-key:
- oinxhibnzuuimr-ixuyqxaasa-j
- molecular-weight:
- 859.631