Difference between revisions of "CPD0-2121"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite D-ERYTHRULOSE == * common-name: ** d-erythrulose * smiles: ** c(o)c(o)c(=o)co * inchi-key: ** uqphvqvxlprncx-gsvougtgsa-n * molecular-wei...")
(Created page with "Category:metabolite == Metabolite CPD0-2121 == * common-name: ** trans-hex-2-enoyl-coa * smiles: ** cccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=...")
 
(5 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite D-ERYTHRULOSE ==
+
== Metabolite CPD0-2121 ==
 
* common-name:
 
* common-name:
** d-erythrulose
+
** trans-hex-2-enoyl-coa
 
* smiles:
 
* smiles:
** c(o)c(o)c(=o)co
+
** cccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
* inchi-key:
** uqphvqvxlprncx-gsvougtgsa-n
+
** oinxhibnzuuimr-ixuyqxaasa-j
 
* molecular-weight:
 
* molecular-weight:
** 120.105
+
** 859.631
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[ERYTHRULOSE-REDUCTASE-RXN]]
+
* [[ECOAH2h]]
* [[RXN-17773]]
+
* [[RXN-12559]]
 +
* [[RXN-14278]]
 +
* [[TRANSENOYLCOARED-RXN-HEXANOYL-COA/NADP//CPD0-2121/NADPH/PROTON.42.]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[ERYTHRULOSE-REDUCTASE-RXN]]
+
* [[ECOAH2h]]
* [[RXN-17773]]
+
* [[RXN-12567]]
 +
* [[RXN-14278]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=d-erythrulose}}
+
{{#set: common-name=trans-hex-2-enoyl-coa}}
{{#set: inchi-key=inchikey=uqphvqvxlprncx-gsvougtgsa-n}}
+
{{#set: inchi-key=inchikey=oinxhibnzuuimr-ixuyqxaasa-j}}
{{#set: molecular-weight=120.105}}
+
{{#set: molecular-weight=859.631}}

Latest revision as of 11:13, 18 March 2021

Metabolite CPD0-2121

  • common-name:
    • trans-hex-2-enoyl-coa
  • smiles:
    • cccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • oinxhibnzuuimr-ixuyqxaasa-j
  • molecular-weight:
    • 859.631

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality