Difference between revisions of "CPD0-2121"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite Starch == * common-name: ** starch == Reaction(s) known to consume the compound == * 3.2.1.1-RXN * RXN-1823 == Reaction(s) known...")
(Created page with "Category:metabolite == Metabolite CPD0-2121 == * common-name: ** trans-hex-2-enoyl-coa * smiles: ** cccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=...")
 
(3 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite Starch ==
+
== Metabolite CPD0-2121 ==
 
* common-name:
 
* common-name:
** starch
+
** trans-hex-2-enoyl-coa
 +
* smiles:
 +
** cccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 +
* inchi-key:
 +
** oinxhibnzuuimr-ixuyqxaasa-j
 +
* molecular-weight:
 +
** 859.631
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[3.2.1.1-RXN]]
+
* [[ECOAH2h]]
* [[RXN-1823]]
+
* [[RXN-12559]]
 +
* [[RXN-14278]]
 +
* [[TRANSENOYLCOARED-RXN-HEXANOYL-COA/NADP//CPD0-2121/NADPH/PROTON.42.]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[ECOAH2h]]
 +
* [[RXN-12567]]
 +
* [[RXN-14278]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=starch}}
+
{{#set: common-name=trans-hex-2-enoyl-coa}}
 +
{{#set: inchi-key=inchikey=oinxhibnzuuimr-ixuyqxaasa-j}}
 +
{{#set: molecular-weight=859.631}}

Latest revision as of 11:13, 18 March 2021

Metabolite CPD0-2121

  • common-name:
    • trans-hex-2-enoyl-coa
  • smiles:
    • cccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • oinxhibnzuuimr-ixuyqxaasa-j
  • molecular-weight:
    • 859.631

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality