Difference between revisions of "CPD0-2123"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Saturated-Fatty-Acyl-ACPs == * common-name: ** a 2,3,4-saturated fatty acyl-[acp] == Reaction(s) known to consume the compound == * 3-O...") |
(Created page with "Category:metabolite == Metabolite CPD0-2123 == * common-name: ** 3-oxodecanoyl-coa * smiles: ** cccccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-]...") |
||
(One intermediate revision by one other user not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD0-2123 == |
* common-name: | * common-name: | ||
− | ** | + | ** 3-oxodecanoyl-coa |
+ | * smiles: | ||
+ | ** cccccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-] | ||
+ | * inchi-key: | ||
+ | ** azcvxmaplhsiky-hsjnekgzsa-j | ||
+ | * molecular-weight: | ||
+ | ** 931.738 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[ACACT4]] |
− | * [[ | + | * [[HACD4h]] |
+ | * [[RXN-13617]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[ACACT4]] |
− | * [[ | + | * [[ACACT4h]] |
+ | * [[HACD4h]] | ||
+ | * [[RXN-12490]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=3-oxodecanoyl-coa}} |
+ | {{#set: inchi-key=inchikey=azcvxmaplhsiky-hsjnekgzsa-j}} | ||
+ | {{#set: molecular-weight=931.738}} |
Latest revision as of 11:14, 18 March 2021
Contents
Metabolite CPD0-2123
- common-name:
- 3-oxodecanoyl-coa
- smiles:
- cccccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
- inchi-key:
- azcvxmaplhsiky-hsjnekgzsa-j
- molecular-weight:
- 931.738