Difference between revisions of "CPD0-2123"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ20511 == * transcription-direction: ** negative * right-end-position: ** 130976 * left-end-position: ** 115943 * centisome-position: ** 55.965416...") |
(Created page with "Category:metabolite == Metabolite CPD0-2123 == * common-name: ** 3-oxodecanoyl-coa * smiles: ** cccccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-]...") |
||
| (7 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite CPD0-2123 == |
| − | * | + | * common-name: |
| − | ** | + | ** 3-oxodecanoyl-coa |
| − | * | + | * smiles: |
| − | ** | + | ** cccccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-] |
| − | * | + | * inchi-key: |
| − | ** | + | ** azcvxmaplhsiky-hsjnekgzsa-j |
| − | * | + | * molecular-weight: |
| − | ** | + | ** 931.738 |
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[ACACT4]] |
| − | + | * [[HACD4h]] | |
| − | * [[ | + | * [[RXN-13617]] |
| − | * | + | == Reaction(s) known to produce the compound == |
| − | * | + | * [[ACACT4]] |
| − | * [[ | + | * [[ACACT4h]] |
| − | * | + | * [[HACD4h]] |
| − | * | + | * [[RXN-12490]] |
| − | == | + | == Reaction(s) of unknown directionality == |
| − | + | {{#set: common-name=3-oxodecanoyl-coa}} | |
| − | + | {{#set: inchi-key=inchikey=azcvxmaplhsiky-hsjnekgzsa-j}} | |
| − | {{#set: | + | {{#set: molecular-weight=931.738}} |
| − | {{#set: | ||
| − | |||
| − | {{#set: | ||
| − | |||
| − | |||
| − | |||
Latest revision as of 11:14, 18 March 2021
Contents
Metabolite CPD0-2123
- common-name:
- 3-oxodecanoyl-coa
- smiles:
- cccccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
- inchi-key:
- azcvxmaplhsiky-hsjnekgzsa-j
- molecular-weight:
- 931.738
