Difference between revisions of "CPD0-2123"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite THR == * common-name: ** l-threonine * smiles: ** cc(o)c([n+])c(=o)[o-] * inchi-key: ** ayfvyjqapqtccc-gbxijsldsa-n * molecular-weight: *...") |
(Created page with "Category:metabolite == Metabolite CPD0-2123 == * common-name: ** 3-oxodecanoyl-coa * smiles: ** cccccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-]...") |
||
| (6 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD0-2123 == |
* common-name: | * common-name: | ||
| − | ** | + | ** 3-oxodecanoyl-coa |
* smiles: | * smiles: | ||
| − | ** cc(o)c([ | + | ** cccccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-] |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** azcvxmaplhsiky-hsjnekgzsa-j |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 931.738 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[ACACT4]] |
| − | + | * [[HACD4h]] | |
| − | + | * [[RXN-13617]] | |
| − | |||
| − | * [[ | ||
| − | * [[ | ||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[ACACT4]] |
| − | * [[ | + | * [[ACACT4h]] |
| − | * [[ | + | * [[HACD4h]] |
| − | * [[ | + | * [[RXN-12490]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=3-oxodecanoyl-coa}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=azcvxmaplhsiky-hsjnekgzsa-j}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=931.738}} |
Latest revision as of 11:14, 18 March 2021
Contents
Metabolite CPD0-2123
- common-name:
- 3-oxodecanoyl-coa
- smiles:
- cccccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
- inchi-key:
- azcvxmaplhsiky-hsjnekgzsa-j
- molecular-weight:
- 931.738
