Difference between revisions of "CPD0-2123"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ13702 == * transcription-direction: ** negative * right-end-position: ** 808378 * left-end-position: ** 785664 * centisome-position: ** 59.286266...")
 
(Created page with "Category:metabolite == Metabolite CPD0-2123 == * common-name: ** 3-oxodecanoyl-coa * smiles: ** cccccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-]...")
 
(9 intermediate revisions by 5 users not shown)
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ13702 ==
+
== Metabolite CPD0-2123 ==
−
* transcription-direction:
+
* common-name:
−
** negative
+
** 3-oxodecanoyl-coa
−
* right-end-position:
+
* smiles:
−
** 808378
+
** cccccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
−
* left-end-position:
+
* inchi-key:
−
** 785664
+
** azcvxmaplhsiky-hsjnekgzsa-j
−
* centisome-position:
+
* molecular-weight:
−
** 59.286266   
+
** 931.738
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
* [[ACACT4]]
−
== Reaction(s) associated ==
+
* [[HACD4h]]
−
* [[2.4.1.145-RXN]]
+
* [[RXN-13617]]
−
** Category: [[annotation]]
+
== Reaction(s) known to produce the compound ==
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[ACACT4]]
−
** Category: [[orthology]]
+
* [[ACACT4h]]
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
* [[HACD4h]]
−
* [[2.4.1.201-RXN]]
+
* [[RXN-12490]]
−
** Category: [[annotation]]
+
== Reaction(s) of unknown directionality ==
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: common-name=3-oxodecanoyl-coa}}
−
* [[2.4.1.223-RXN]]
+
{{#set: inchi-key=inchikey=azcvxmaplhsiky-hsjnekgzsa-j}}
−
** Category: [[annotation]]
+
{{#set: molecular-weight=931.738}}
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN-7873]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
** Category: [[orthology]]
 
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
== Pathway(s) associated ==
 
−
* [[PWY-7426]]
 
−
** '''4''' reactions found over '''10''' reactions in the full pathway
 
−
* [[PWY-6558]]
 
−
** '''7''' reactions found over '''13''' reactions in the full pathway
 
−
{{#set: transcription-direction=negative}}
 
−
{{#set: right-end-position=808378}}
 
−
{{#set: left-end-position=785664}}
 
−
{{#set: centisome-position=59.286266    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=4}}
 
−
{{#set: nb pathway associated=2}}
 

Latest revision as of 11:14, 18 March 2021

Metabolite CPD0-2123

  • common-name:
    • 3-oxodecanoyl-coa
  • smiles:
    • cccccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • azcvxmaplhsiky-hsjnekgzsa-j
  • molecular-weight:
    • 931.738

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD0-2123&oldid=138352"