Difference between revisions of "CPD0-2123"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-17372 == * common-name: ** 1-[18-hydroxyoleyl]-2-lyso-phosphatidate * smiles: ** c(o)cccccccc=ccccccccc(=o)occ(cop([o-])([o-])=o)o *...")
(Created page with "Category:metabolite == Metabolite Saturated-Fatty-Acyl-ACPs == * common-name: ** a 2,3,4-saturated fatty acyl-[acp] == Reaction(s) known to consume the compound == * 3-O...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-17372 ==
+
== Metabolite Saturated-Fatty-Acyl-ACPs ==
 
* common-name:
 
* common-name:
** 1-[18-hydroxyoleyl]-2-lyso-phosphatidate
+
** a 2,3,4-saturated fatty acyl-[acp]
* smiles:
 
** c(o)cccccccc=ccccccccc(=o)occ(cop([o-])([o-])=o)o
 
* inchi-key:
 
** gfjkjlhwwzxdau-kxfgnqbasa-l
 
* molecular-weight:
 
** 450.508
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-16118]]
+
* [[3-OXOACYL-ACP-SYNTH-RXN]]
 +
* [[RXN0-5514]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-16117]]
+
* [[ENOYL-ACP-REDUCT-NADH-RXN]]
 +
* [[ENOYL-ACP-REDUCT-NADPH-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=1-[18-hydroxyoleyl]-2-lyso-phosphatidate}}
+
{{#set: common-name=a 2,3,4-saturated fatty acyl-[acp]}}
{{#set: inchi-key=inchikey=gfjkjlhwwzxdau-kxfgnqbasa-l}}
 
{{#set: molecular-weight=450.508}}
 

Revision as of 15:28, 5 January 2021

Metabolite Saturated-Fatty-Acyl-ACPs

  • common-name:
    • a 2,3,4-saturated fatty acyl-[acp]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a 2,3,4-saturated fatty acyl-[acp" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.