Difference between revisions of "CPD0-2152"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 2-PG == * common-name: ** 2-phospho-d-glycerate * smiles: ** c(=o)([o-])c(op(=o)([o-])[o-])co * inchi-key: ** gxiurptvhjpjlf-uwtatzphsa-k...") |
(Created page with "Category:metabolite == Metabolite CPD0-2152 == * common-name: ** 1-18:0-2-lysophosphatidylethanolamine * smiles: ** cccccccccccccccccc(occ(o)cop([o-])(=o)occ[n+])=o * inch...") |
||
| (3 intermediate revisions by 2 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD0-2152 == |
* common-name: | * common-name: | ||
| − | ** | + | ** 1-18:0-2-lysophosphatidylethanolamine |
* smiles: | * smiles: | ||
| − | ** | + | ** cccccccccccccccccc(occ(o)cop([o-])(=o)occ[n+])=o |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** bbywoyafbuoufp-jochjyfzsa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 481.608 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[LPLPS1AGPE180h]] |
| − | |||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=1-18:0-2-lysophosphatidylethanolamine}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=bbywoyafbuoufp-jochjyfzsa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=481.608}} |
Latest revision as of 11:14, 18 March 2021
Contents
Metabolite CPD0-2152
- common-name:
- 1-18:0-2-lysophosphatidylethanolamine
- smiles:
- cccccccccccccccccc(occ(o)cop([o-])(=o)occ[n+])=o
- inchi-key:
- bbywoyafbuoufp-jochjyfzsa-n
- molecular-weight:
- 481.608
