Difference between revisions of "CPD0-2184"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=LCYSDESULF-RXN LCYSDESULF-RXN] == * direction: ** left-to-right * common-name: ** cystathionine gam...")
(Created page with "Category:metabolite == Metabolite CPD0-2184 == * common-name: ** (2z,4e,7e)-2-hydroxy-6-oxonona-2,4,7-triene-1,9-dioate * smiles: ** c([o-])(=o)c=cc(=o)c=cc=c(c([o-])=o)o...")
 
(7 intermediate revisions by 2 users not shown)
Line 1: Line 1:
[[Category:reaction]]
+
[[Category:metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=LCYSDESULF-RXN LCYSDESULF-RXN] ==
+
== Metabolite CPD0-2184 ==
* direction:
 
** left-to-right
 
 
* common-name:
 
* common-name:
** cystathionine gamma-lyase
+
** (2z,4e,7e)-2-hydroxy-6-oxonona-2,4,7-triene-1,9-dioate
* ec-number:
+
* smiles:
** [http://enzyme.expasy.org/EC/4.4.1.1 ec-4.4.1.1]
+
** c([o-])(=o)c=cc(=o)c=cc=c(c([o-])=o)o
** [http://enzyme.expasy.org/EC/4.4.1.28 ec-4.4.1.28]
+
* inchi-key:
== Reaction formula ==
+
** wcjyzufkktynlb-aritwgjrsa-l
* 1 [[CYS]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[AMMONIUM]][c] '''+''' 1 [[HS]][c] '''+''' 1 [[PYRUVATE]][c]
+
* molecular-weight:
== Gene(s) associated with this reaction  ==
+
** 210.143
* Gene: [[SJ05358]]
+
== Reaction(s) known to consume the compound ==
** Category: [[annotation]]
+
* [[RXN-12070]]
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
+
== Reaction(s) known to produce the compound ==
* Gene: [[SJ20026]]
+
== Reaction(s) of unknown directionality ==
** Category: [[annotation]]
+
{{#set: common-name=(2z,4e,7e)-2-hydroxy-6-oxonona-2,4,7-triene-1,9-dioate}}
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
{{#set: inchi-key=inchikey=wcjyzufkktynlb-aritwgjrsa-l}}
** Category: [[orthology]]
+
{{#set: molecular-weight=210.143}}
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
 
* Gene: [[SJ05357]]
 
** Category: [[annotation]]
 
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
 
== Pathway(s) ==
 
* [[PWY66-426]], hydrogen sulfide biosynthesis II (mammalian): [http://metacyc.org/META/NEW-IMAGE?object=PWY66-426 PWY66-426]
 
** '''2''' reactions found over '''6''' reactions in the full pathway
 
== Reconstruction information  ==
 
* category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
== External links  ==
 
* RHEA:
 
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=24932 24932]
 
* LIGAND-RXN:
 
** [http://www.genome.jp/dbget-bin/www_bget?R00782 R00782]
 
{{#set: direction=left-to-right}}
 
{{#set: common-name=cystathionine gamma-lyase}}
 
{{#set: ec-number=ec-4.4.1.28|ec-4.4.1.1}}
 
{{#set: nb gene associated=3}}
 
{{#set: nb pathway associated=1}}
 
{{#set: reconstruction category=annotation|orthology}}
 
{{#set: reconstruction tool=pantograph|pathwaytools}}
 
{{#set: reconstruction comment=n.a}}
 
{{#set: reconstruction source=output_pantograph_ectocarpus_siliculosus|saccharina_japonica_genome}}
 

Latest revision as of 11:17, 18 March 2021

Metabolite CPD0-2184

  • common-name:
    • (2z,4e,7e)-2-hydroxy-6-oxonona-2,4,7-triene-1,9-dioate
  • smiles:
    • c([o-])(=o)c=cc(=o)c=cc=c(c([o-])=o)o
  • inchi-key:
    • wcjyzufkktynlb-aritwgjrsa-l
  • molecular-weight:
    • 210.143

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality