Difference between revisions of "CPD0-2189"

Revision as of 18:58, 14 January 2021

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite L-BETA-ASPARTYL-P ==
+== Metabolite CPD-15382 ==
 * common-name:
-** l-aspartyl-4-phosphate
+** keto-d-fructose
 * smiles:
-** c(c([n+])c(=o)[o-])c(=o)op([o-])(=o)[o-]
+** c(o)c(=o)c(o)c(o)c(o)co
 * inchi-key:
-** ixznktpiykdigg-reohclbhsa-l
+** bjhikxhvcxfqls-uyfozjqfsa-n
 * molecular-weight:
-** 211.068
+** 180.157
 == Reaction(s) known to consume the compound ==
-* [[ASPARTATE-SEMIALDEHYDE-DEHYDROGENASE-RXN]]
+* [[GLUCISOM-RXN]]
-* [[ASPARTATEKIN-RXN]]
+* [[GLUCISOM-RXN-ALPHA-GLUCOSE//CPD-15382.25.]]
+* [[GLUCISOM-RXN-GLC//CPD-15382.15.]]
+* [[MANNITOL-2-DEHYDROGENASE-RXN]]
+* [[RXN-7644]]
 == Reaction(s) known to produce the compound ==
-* [[ASPARTATE-SEMIALDEHYDE-DEHYDROGENASE-RXN]]
+* [[GLUCISOM-RXN]]
-* [[ASPARTATEKIN-RXN]]
+* [[GLUCISOM-RXN-ALPHA-GLUCOSE//CPD-15382.25.]]
+* [[GLUCISOM-RXN-GLC//CPD-15382.15.]]
+* [[MANNITOL-2-DEHYDROGENASE-RXN]]
+* [[RXN-7644]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=l-aspartyl-4-phosphate}}
+{{#set: common-name=keto-d-fructose}}
-{{#set: inchi-key=inchikey=ixznktpiykdigg-reohclbhsa-l}}
+{{#set: inchi-key=inchikey=bjhikxhvcxfqls-uyfozjqfsa-n}}
-{{#set: molecular-weight=211.068}}
+{{#set: molecular-weight=180.157}}