Difference between revisions of "CPD0-2189"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-6993 == * common-name: ** pinocembrin chalcone * smiles: ** c2(c=cc(c=cc(c1(=c(c=c(c=c(o)1)o)o))=o)=cc=2) * inchi-key: ** loyxtwzxlwh...") |
(Created page with "Category:metabolite == Metabolite CPD0-2189 == * common-name: ** 4-hydroxy-l-threonine * smiles: ** c(o)c(o)c([n+])c(=o)[o-] * inchi-key: ** jbnuarfqocgdrk-gbxijsldsa-n *...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD0-2189 == |
* common-name: | * common-name: | ||
− | ** | + | ** 4-hydroxy-l-threonine |
* smiles: | * smiles: | ||
− | ** | + | ** c(o)c(o)c([n+])c(=o)[o-] |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** jbnuarfqocgdrk-gbxijsldsa-n |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 135.119 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[RXN-14125]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=4-hydroxy-l-threonine}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=jbnuarfqocgdrk-gbxijsldsa-n}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=135.119}} |
Latest revision as of 11:17, 18 March 2021
Contents
Metabolite CPD0-2189
- common-name:
- 4-hydroxy-l-threonine
- smiles:
- c(o)c(o)c([n+])c(=o)[o-]
- inchi-key:
- jbnuarfqocgdrk-gbxijsldsa-n
- molecular-weight:
- 135.119