Difference between revisions of "CPD0-2231"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ01094 == == Organism(s) associated with this gene == * S.japonica_carotenoid_curated == Reaction(s) associated == * 4.2.2.10-RXN ** Catego...") |
(Created page with "Category:metabolite == Metabolite CPD0-2231 == * common-name: ** didp * smiles: ** c(op(=o)([o-])op(=o)([o-])[o-])c1(oc(cc(o)1)n3(c=nc2(c(=o)nc=nc=23))) * inchi-key: ** bk...") |
||
| (8 intermediate revisions by 4 users not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite CPD0-2231 == |
| − | = | + | * common-name: |
| − | + | ** didp | |
| − | == | + | * smiles: |
| − | * | + | ** c(op(=o)([o-])op(=o)([o-])[o-])c1(oc(cc(o)1)n3(c=nc2(c(=o)nc=nc=23))) |
| − | ** | + | * inchi-key: |
| − | ** | + | ** bkusikgspsfqac-rrkcrqdmsa-k |
| − | * [[RXN- | + | * molecular-weight: |
| − | + | ** 409.165 | |
| − | + | == Reaction(s) known to consume the compound == | |
| − | == | + | * [[RXN-14228]] |
| − | * [[ | + | == Reaction(s) known to produce the compound == |
| − | + | * [[RXN-14228]] | |
| − | {{#set: | + | == Reaction(s) of unknown directionality == |
| − | {{#set: | + | {{#set: common-name=didp}} |
| − | {{#set: | + | {{#set: inchi-key=inchikey=bkusikgspsfqac-rrkcrqdmsa-k}} |
| + | {{#set: molecular-weight=409.165}} | ||
Latest revision as of 11:11, 18 March 2021
Contents
Metabolite CPD0-2231
- common-name:
- didp
- smiles:
- c(op(=o)([o-])op(=o)([o-])[o-])c1(oc(cc(o)1)n3(c=nc2(c(=o)nc=nc=23)))
- inchi-key:
- bkusikgspsfqac-rrkcrqdmsa-k
- molecular-weight:
- 409.165
