Difference between revisions of "CPD0-2231"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite GERANYL-PP == * common-name: ** geranyl diphosphate * smiles: ** cc(=cccc(=ccop([o-])(op(=o)([o-])[o-])=o)c)c * inchi-key: ** gvvpgtzrzfn...") |
(Created page with "Category:metabolite == Metabolite ETHYLENE-CMPD == * common-name: ** ethene * smiles: ** c=c * inchi-key: ** vggsqfucumxweo-uhfffaoysa-n * molecular-weight: ** 28.054 == R...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite ETHYLENE-CMPD == |
* common-name: | * common-name: | ||
− | ** | + | ** ethene |
* smiles: | * smiles: | ||
− | ** | + | ** c=c |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** vggsqfucumxweo-uhfffaoysa-n |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 28.054 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[ETHYL-RXN]] |
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=ethene}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=vggsqfucumxweo-uhfffaoysa-n}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=28.054}} |
Revision as of 08:24, 15 March 2021
Contents
Metabolite ETHYLENE-CMPD
- common-name:
- ethene
- smiles:
- c=c
- inchi-key:
- vggsqfucumxweo-uhfffaoysa-n
- molecular-weight:
- 28.054